CAS 175136-07-9: 2-[(2,3-Dihydro-7-methyl-1H-inden-4-yl)oxy]-2-methylpropanoic acid

Description:2-[(2,3-Dihydro-7-methyl-1H-inden-4-yl)oxy]-2-methylpropanoic acid, with the CAS number 175136-07-9, is a chemical compound characterized by its unique structure that includes an indene derivative and a carboxylic acid functional group. This compound features a branched alkyl chain, which contributes to its hydrophobic properties, while the carboxylic acid group imparts acidity and potential for hydrogen bonding. The presence of the indene moiety suggests that it may exhibit interesting aromatic characteristics, influencing its reactivity and interactions with other molecules. Typically, compounds of this nature may be studied for their potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. The specific stereochemistry and substituents can significantly affect its biological activity and solubility. As with many organic compounds, its stability, solubility, and reactivity can vary based on environmental conditions such as pH and temperature. Further studies would be necessary to fully elucidate its properties and potential applications in various fields.

Formula:C₁₄H₁₈O₃

InChI:InChI=1S/C14H18O3/c1-9-7-8-12(11-6-4-5-10(9)11)17-14(2,3)13(15)16/h7-8H,4-6H2,1-3H3,(H,15,16)

InChI key:InChIKey=WIBSAUIOPNFINN-UHFFFAOYSA-N

SMILES:O=C(O)C(OC1=CC=C(C2=C1CCC2)C)(C)C