CAS 175136-79-5: 1-(3,5-Dichlorophenyl)-1H-pyrrole-2-carboxaldehyde
Description:1-(3,5-Dichlorophenyl)-1H-pyrrole-2-carboxaldehyde is an organic compound characterized by its pyrrole ring structure, which is a five-membered aromatic heterocycle containing nitrogen. The presence of a carboxaldehyde functional group (-CHO) indicates that it can participate in various chemical reactions, such as nucleophilic additions. The compound features a dichlorophenyl substituent, which enhances its reactivity and may influence its biological activity due to the electron-withdrawing nature of the chlorine atoms. This compound is typically used in research and development, particularly in the fields of medicinal chemistry and material science, due to its potential as a building block for synthesizing more complex molecules. Its physical properties, such as solubility and melting point, can vary based on the specific conditions and purity of the sample. Safety data should be consulted, as compounds with halogenated groups can exhibit toxicity or environmental concerns. Overall, 1-(3,5-Dichlorophenyl)-1H-pyrrole-2-carboxaldehyde is a versatile compound with applications in various chemical syntheses.
Formula:C11H7Cl2NO
InChI:InChI=1S/C11H7Cl2NO/c12-8-4-9(13)6-11(5-8)14-3-1-2-10(14)7-15/h1-7H
InChI key:InChIKey=GNBDQGBCNPLAQK-UHFFFAOYSA-N
SMILES:O=CC1=CC=CN1C=2C=C(Cl)C=C(Cl)C2
- Synonyms:
- 1-(3,5-Dichlorophenyl)-1H-Pyrrole-2-Carboxaldehyde
- 1-(3,5-Dichlorophenyl)pyrrole-2-carbaldehyde
- 1-(3,5-Dichlorophenyl)pyrrole-2-carboxaldehyde
- 1H-Pyrrole-2-carboxaldehyde, 1-(3,5-dichlorophenyl)-
- N-(3,5-Dichlorophenyl)pyrrole-2-carboxaldehyde

1H-Pyrrole-2-carboxaldehyde, 1-(3,5-dichlorophenyl)-
Ref: IN-DA0020AN
Undefined size | To inquire |

Ref: 54-OR23813
Undefined size | To inquire |

1-(3,5-Dichloro-phenyl)-1H-pyrrole-2-carbaldehyde
Ref: 10-F317293
1g | To inquire | ||
5g | To inquire | ||
10g | To inquire |

1-(3,5-dichlorophenyl)-1H-pyrrole-2-carbaldehyde
Ref: 3D-AHA13679
5g | 1,726.00 € | ||
500mg | 505.00 € |