CAS 1752-94-9: 4-(4,5-diphenyl-1,3-dihydro-2H-imidazol-2-ylidene)cyclohexa-2,5-dien-1-one
Description:4-(4,5-diphenyl-1,3-dihydro-2H-imidazol-2-ylidene)cyclohexa-2,5-dien-1-one, with the CAS number 1752-94-9, is a complex organic compound characterized by its unique structural features. It contains an imidazolium moiety, which contributes to its potential as a ligand in coordination chemistry. The presence of the cyclohexadienone structure indicates that it may exhibit interesting electronic properties, including potential reactivity in various chemical transformations. This compound is likely to be a yellow or orange solid, reflecting its conjugated system, which can absorb light in the visible spectrum. Its molecular structure suggests that it may participate in π-π stacking interactions, making it of interest in materials science and organic electronics. Additionally, the presence of multiple phenyl groups can enhance its stability and solubility in organic solvents. Overall, this compound's unique combination of features positions it as a valuable candidate for research in fields such as catalysis, organic synthesis, and materials development.
Formula:C21H16N2O
InChI:InChI=1/C21H16N2O/c24-18-13-11-17(12-14-18)21-22-19(15-7-3-1-4-8-15)20(23-21)16-9-5-2-6-10-16/h1-14,22-23H
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 4-(4,5-Diphenyl-1H-imidazol-2-yl)phenol [for Biochemical Research] REF: 3B-D4178CAS: 1752-94-9 | >98.0%(T)(HPLC) | 66.00 € | Thu 20 Mar 25 |
![]() | Phenol, 4-(4,5-diphenyl-1H-imidazol-2-yl)- REF: IN-DA0020EQCAS: 1752-94-9 | 98% | 170.00 € | Thu 27 Mar 25 |
![]() | 4-(4,5-Diphenyl-1H-imidazol-2-yl)phenol [for Biochemical Research] REF: 3D-BAA75294CAS: 1752-94-9 | Min. 95% | - - - | Discontinued product |

4-(4,5-Diphenyl-1H-imidazol-2-yl)phenol [for Biochemical Research]
Ref: 3B-D4178
100mg | 66.00 € |

Phenol, 4-(4,5-diphenyl-1H-imidazol-2-yl)-
Ref: IN-DA0020EQ
100mg | 170.00 € |

4-(4,5-Diphenyl-1H-imidazol-2-yl)phenol [for Biochemical Research]
Ref: 3D-BAA75294
1g | Discontinued | Request information | |
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |