CAS 175201-59-9: 3-Amino-4-(phenylsulfonyl)-2-thiophenecarboxylic acid
Description:3-Amino-4-(phenylsulfonyl)-2-thiophenecarboxylic acid is an organic compound characterized by its thiophene ring structure, which is a five-membered aromatic heterocycle containing sulfur. This compound features an amino group (-NH2) and a carboxylic acid group (-COOH), contributing to its potential as an acid and a base, thus exhibiting amphoteric properties. The presence of the phenylsulfonyl group enhances its reactivity and solubility in various solvents, making it useful in medicinal chemistry and as a building block in organic synthesis. The sulfonyl group can also participate in various chemical reactions, such as nucleophilic substitutions. This compound may exhibit biological activity, potentially serving as a lead compound in drug development, particularly in targeting specific enzymes or receptors. Its molecular structure allows for various interactions with biological systems, which can be explored in pharmacological studies. Overall, 3-Amino-4-(phenylsulfonyl)-2-thiophenecarboxylic acid is a versatile compound with significant implications in both synthetic and medicinal chemistry.
Formula:C11H9NO4S2
InChI:InChI=1S/C11H9NO4S2/c12-9-8(6-17-10(9)11(13)14)18(15,16)7-4-2-1-3-5-7/h1-6H,12H2,(H,13,14)
InChI key:InChIKey=YXMYJEUQTGKJPV-UHFFFAOYSA-N
SMILES:O=C(O)C=1SC=C(C1N)S(=O)(=O)C=2C=CC=CC2
- Synonyms:
- 2-Thiophenecarboxylic acid, 3-amino-4-(phenylsulfonyl)-
- 3-Amino-4-(benzenesulfonyl)thiophene-2-carboxylic acid
- 3-Amino-4-(phenylsulfonyl)-2-thiophenecarboxylic acid
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 2-Thiophenecarboxylic acid, 3-amino-4-(phenylsulfonyl)- REF: IN-DA0020E7CAS: 175201-59-9 | - - - | To inquire | Thu 27 Mar 25 |
![]() | 3-Amino-4-(phenylsulphonyl)thiophene-2-carboxylic acid REF: 54-OR25138CAS: 175201-59-9 | - - - | 188.00 €~821.00 € | Fri 28 Mar 25 |
![]() | 3-Amino-4-(phenylsulfonyl)thiophene-2-carboxylic acid REF: 10-F437542CAS: 175201-59-9 | 95.0% | - - - | Discontinued product |

2-Thiophenecarboxylic acid, 3-amino-4-(phenylsulfonyl)-
Ref: IN-DA0020E7
Undefined size | To inquire |

3-Amino-4-(phenylsulphonyl)thiophene-2-carboxylic acid
Ref: 54-OR25138
1g | 188.00 € | ||
5g | 821.00 € |

3-Amino-4-(phenylsulfonyl)thiophene-2-carboxylic acid
Ref: 10-F437542
1g | Discontinued | Request information |