CAS 175204-57-6: 4-cyclopropyl-6-(methylthio)-1,3,5-triazin-2-amine
Description:4-Cyclopropyl-6-(methylthio)-1,3,5-triazin-2-amine, with the CAS number 175204-57-6, is a chemical compound that belongs to the class of triazines, which are characterized by a six-membered ring containing three nitrogen atoms. This compound features a cyclopropyl group, which is a three-membered carbon ring, contributing to its unique structural properties and potential reactivity. The presence of a methylthio group indicates that it contains a sulfur atom bonded to a methyl group, which can influence its chemical behavior and interactions. Triazines are often studied for their applications in agriculture, particularly as herbicides or fungicides, due to their ability to inhibit specific biochemical pathways in plants. The specific arrangement of substituents in this compound may also impart distinct biological activities or pharmacological properties. Overall, the characteristics of this compound, including its molecular structure and functional groups, suggest potential utility in various chemical and biological applications, warranting further investigation into its properties and uses.
Formula:C7H10N4S
InChI:InChI=1/C7H10N4S/c1-12-7-10-5(4-2-3-4)9-6(8)11-7/h4H,2-3H2,1H3,(H2,8,9,10,11)
- Synonyms:
- 4-Cyclopropyl-6-(Methylsulfanyl)-1,3,5-Triazin-2-Amine
