CAS 175276-93-4: Ethyl 2-(2,4-difluorophenyl)-4-thiazolecarboxylate
Description:Ethyl 2-(2,4-difluorophenyl)-4-thiazolecarboxylate is a chemical compound characterized by its thiazole and difluorophenyl moieties. It features a thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen, contributing to its biological activity and potential applications in pharmaceuticals. The presence of the ethyl ester group enhances its solubility and reactivity, making it suitable for various chemical reactions. The difluorophenyl substituent introduces electron-withdrawing fluorine atoms, which can influence the compound's electronic properties and reactivity. This compound may exhibit interesting biological activities, making it a candidate for research in medicinal chemistry. Its molecular structure suggests potential applications in drug development, particularly in targeting specific biological pathways. Additionally, the compound's stability and reactivity can be influenced by the presence of the thiazole and difluorophenyl groups, which may affect its interactions with other molecules. Overall, Ethyl 2-(2,4-difluorophenyl)-4-thiazolecarboxylate is a compound of interest in the field of organic chemistry and medicinal research.
Formula:C12H9F2NO2S
InChI:InChI=1S/C12H9F2NO2S/c1-2-17-12(16)10-6-18-11(15-10)8-4-3-7(13)5-9(8)14/h3-6H,2H2,1H3
InChI key:InChIKey=QZWCWKKYIGCUOG-UHFFFAOYSA-N
SMILES:O=C(OCC)C=1N=C(SC1)C=2C=CC(F)=CC2F
- Synonyms:
- 2-(2,4-Difluorophenyl)thiazole-4-carboxylic acid ethyl ester
- 4-Thiazolecarboxylic acid, 2-(2,4-difluorophenyl)-, ethyl ester
- Ethyl 2-(2,4-difluorophenyl)-1,3-thiazole-4-carboxylate
- Ethyl 2-(2,4-difluorophenyl)-4-thiazolecarboxylate

Ethyl 2-(2,4-difluorophenyl)thiazole-4-carboxylate
Ref: 10-F008305
1g | 137.00 € | ||
250mg | 97.00 € |

4-Thiazolecarboxylic acid, 2-(2,4-difluorophenyl)-, ethyl ester
Ref: IN-DA0020RN
Undefined size | To inquire |

Ethyl 2-(2,4-difluorophenyl)thiazole-4-carboxylate
Ref: 54-PC3213
1g | 113.00 € |

Ethyl 2-(2,4-Difluorophenyl)-1,3-Thiazole-4-Carboxylate
Ref: 3D-FE94454
Undefined size | Discontinued | Request information |