CAS 175276-94-5: 3-Thiopheneacetic acid hydrazide
Description:3-Thiopheneacetic acid hydrazide is an organic compound characterized by the presence of a thiophene ring, which is a five-membered aromatic heterocycle containing sulfur. This compound features a hydrazide functional group, which is derived from the reaction of hydrazine with a carboxylic acid, in this case, 3-thiopheneacetic acid. The molecular structure typically exhibits properties such as moderate solubility in polar solvents due to the presence of the hydrazide group, while the thiophene moiety contributes to its aromatic characteristics. 3-Thiopheneacetic acid hydrazide may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of new drugs or agrochemicals. Its reactivity can be influenced by the functional groups present, allowing for potential derivatization and modification. Additionally, the compound's stability and behavior under various conditions, such as temperature and pH, are important for its applications in synthesis and biological studies. Overall, 3-thiopheneacetic acid hydrazide is a compound of interest in both organic chemistry and medicinal chemistry.
Formula:C6H8N2OS
InChI:InChI=1S/C6H8N2OS/c7-8-6(9)3-5-1-2-10-4-5/h1-2,4H,3,7H2,(H,8,9)
InChI key:InChIKey=YNMRDHMMFCGQBD-UHFFFAOYSA-N
SMILES:O=C(NN)CC1=CSC=C1
- Synonyms:
- 2-(3-Thienyl)acetic acid hydrazide
- 2-(3-Thienyl)ethanohydrazide
- 2-(Thiophen-3-yl)acetohydrazide
- 2-Thiophen-3-Ylacetohydrazide
- 3-Thiopheneacetic acid hydrazide
- [3]Thienyl-acetic acid hydrazide
Thiophene-3-acetic acid hydrazide, 97%
Ref: 02-L12077
| 1g | To inquire | ||
| 5g | To inquire |
3-Thiopheneacetic acid, hydrazide
Ref: IN-DA0020RM
| Undefined size | To inquire |
Ref: 54-OR29655
| 1g | 161.00 € |
2-(Thiophen-3-yl)acetohydrazide
Ref: 10-F771276
| 1g | 122.00 € | ||
| 5g | To inquire |
2-(Thiophen-3-yl)acetohydrazide
Ref: 3D-AHA27694
| 250mg | Discontinued | Request information | |
| 2500mg | Discontinued | Request information |
