CAS 175278-00-9: 1-Iodo-2-(trifluoromethoxy)benzene
Description:1-Iodo-2-(trifluoromethoxy)benzene is an organic compound characterized by the presence of an iodine atom and a trifluoromethoxy group attached to a benzene ring. This compound features a benzene structure, which is a stable aromatic system, contributing to its chemical stability and unique reactivity. The iodine substituent is known for its ability to participate in nucleophilic substitution reactions, while the trifluoromethoxy group enhances the compound's electron-withdrawing properties, influencing its reactivity and solubility in various solvents. The presence of fluorine atoms in the trifluoromethoxy group also imparts distinctive physical properties, such as increased lipophilicity and potential for strong intermolecular interactions. Additionally, the compound may exhibit interesting biological activities, making it of interest in medicinal chemistry and material science. Its synthesis typically involves halogenation and etherification reactions, and it can be utilized in various applications, including as an intermediate in the synthesis of pharmaceuticals and agrochemicals. Safety precautions should be observed when handling this compound due to the presence of iodine and fluorinated groups.
Formula:C7H4F3IO
InChI:InChI=1S/C7H4F3IO/c8-7(9,10)12-6-4-2-1-3-5(6)11/h1-4H
InChI key:InChIKey=GYBMJVZOZTVDKS-UHFFFAOYSA-N
SMILES:FC(F)(F)OC=1C=CC=CC1I
- Synonyms:
- 1-Iodo-2-(trifluoromethoxy)benzene
- 2-(Trifluoromethoxy)iodobenzene
- 2-Iodo-1-trifluoromethoxybenzene
- 2-Trifluoromethoxy-1-iodobenzene
- 2-Trifluoromethoxyphenyl iodide
- Benzene, 1-iodo-2-(trifluoromethoxy)-
- [4-(Trifluoromethoxy)Phenyl]Methanethiol

1-Iodo-2-(trifluoromethoxy)benzene
Ref: 3B-T2152
5g | 80.00 € |

Benzene, 1-iodo-2-(trifluoromethoxy)-
Ref: IN-DA0020TV
1g | 25.00 € | ||
5g | 26.00 € | ||
10g | 26.00 € | ||
25g | 32.00 € | ||
100g | 69.00 € |

1-Iodo-2-(trifluoromethoxy)benzene
Ref: 54-PC7439E
25g | 32.00 € | ||
100g | 64.00 € |

Ref: FT-T14468
1g | To inquire | ||
5g | To inquire |

2-(Trifluoromethoxy)iodobenzene
Ref: 10-F007557
1g | 24.00 € | ||
5g | 20.00 € | ||
25g | 23.00 € | ||
100g | 58.00 € |

1-iodo-2-(trifluoromethoxy)benzene
Ref: 3D-FI106162
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
25g | Discontinued | Request information |