CAS 175533-32-1: 5-Quinolinecarboxamide

Description:5-Quinolinecarboxamide, identified by its CAS number 175533-32-1, is a chemical compound that features a quinoline ring structure, which is a bicyclic aromatic compound consisting of a benzene ring fused to a pyridine ring. This compound typically exhibits characteristics such as being a solid at room temperature and possessing moderate solubility in organic solvents. Its molecular structure includes an amide functional group, which contributes to its potential biological activity and interactions. 5-Quinolinecarboxamide may be of interest in medicinal chemistry due to its potential applications in drug development, particularly in the context of antimicrobial or anticancer agents. The presence of the quinoline moiety often correlates with various pharmacological properties, making it a subject of research in various fields, including biochemistry and pharmacology. Additionally, the compound's stability and reactivity can be influenced by the specific substituents on the quinoline ring, which can affect its overall chemical behavior and potential applications.

Formula:C₁₀H₈N₂O

InChI:InChI=1S/C10H8N2O/c11-10(13)8-3-1-5-9-7(8)4-2-6-12-9/h1-6H,(H2,11,13)

InChI key:InChIKey=LZHJFZLHEGJWAU-UHFFFAOYSA-N

SMILES:O=C(N)C1=CC=CC2=NC=CC=C21