
CAS 1758-77-6: (2S)-2-Aziridinecarboxylic acid
Description:(2S)-2-Aziridinecarboxylic acid, also known as L-azetidine-2-carboxylic acid, is a cyclic amino acid characterized by its three-membered aziridine ring structure, which contains a carboxylic acid functional group. This compound is notable for its chirality, with the (2S) designation indicating the specific stereochemistry at the second carbon atom. It is a colorless to pale yellow solid that is soluble in water and polar organic solvents. The presence of the aziridine ring contributes to its unique reactivity, making it a valuable intermediate in organic synthesis and medicinal chemistry. Its carboxylic acid group can participate in various chemical reactions, including esterification and amidation. Additionally, (2S)-2-Aziridinecarboxylic acid has been studied for its potential biological activities, including its role in the synthesis of peptides and other bioactive compounds. Overall, this compound serves as an important building block in the development of pharmaceuticals and agrochemicals.
Formula:C3H5NO2
InChI:InChI=1S/C3H5NO2/c5-3(6)2-1-4-2/h2,4H,1H2,(H,5,6)/t2-/m0/s1
InChI key:InChIKey=WBGBOXYJYPVLQJ-REOHCLBHSA-N
SMILES:O=C(O)C1NC1
- Synonyms:
- 2-Aziridinecarboxylic acid, (S)-
- 2-Aziridinecarboxylic acid (L-)
- 2-Aziridinecarboxylic acid, (2S)-
- L-2-Aziridinecarboxylic acid
- (2S)-2-Aziridinecarboxylic acid
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 2-Aziridinecarboxylic acid, (2S)- REF: IN-DA00217HCAS: 1758-77-6 | - - - | To inquire | Thu 27 Mar 25 |
![]() | (S)-Aziridine-2-carboxylic acid REF: 10-F617561CAS: 1758-77-6 | 95+% | - - - | Discontinued product |
![]() | L-2-Aziridinecarboxylic acid REF: 3D-BAA75877CAS: 1758-77-6 | Min. 95% | - - - | Discontinued product |

Ref: IN-DA00217H
Undefined size | To inquire |

Ref: 10-F617561
1g | Discontinued | Request information |

L-2-Aziridinecarboxylic acid
Ref: 3D-BAA75877
10mg | Discontinued | Request information | |
100mg | Discontinued | Request information |