CAS 176032-72-7: 3-(3-Quinolinyl)benzenamine

Description:3-(3-Quinolinyl)benzenamine, with the CAS number 176032-72-7, is an organic compound characterized by its structure, which features a quinoline moiety attached to a benzene ring through an amine group. This compound typically exhibits properties associated with both aromatic systems, such as stability and potential for π-π stacking interactions. It is likely to be a solid at room temperature, given the presence of multiple aromatic rings, which contribute to its overall stability and melting point. The amine functional group may impart basicity and can participate in hydrogen bonding, influencing its solubility in various solvents. Additionally, compounds of this type may exhibit biological activity, making them of interest in medicinal chemistry and drug development. The presence of the quinoline structure suggests potential applications in pharmaceuticals, particularly in the development of compounds with antimicrobial or anticancer properties. Overall, 3-(3-Quinolinyl)benzenamine is a compound of interest due to its unique structural features and potential applications in various fields of chemistry and biology.

Formula:C₁₅H₁₂N₂

InChI:InChI=1S/C15H12N2/c16-14-6-3-5-11(9-14)13-8-12-4-1-2-7-15(12)17-10-13/h1-10H,16H2

InChI key:InChIKey=RUODYRDLFIKXQM-UHFFFAOYSA-N

SMILES:N1=CC(=CC2=CC=CC=C12)C3=CC=CC(N)=C3

Synonyms:
3-(3-Quinolinyl)benzenamine
3-(Quinolin-3-yl)aniline
Benzenamine, 3-(3-quinolinyl)-

Found 2 products.

Brand	Product data	Purity	Price range	Estimated delivery
	3-Quinolin-3-yl-phenylamine REF: 10-F034539CAS: 176032-72-7	- - -	- - -	Discontinued product
	3-Quinolin-3-yl-phenylamine REF: 3D-BHA03272CAS: 176032-72-7	Min. 95%	- - -	Discontinued product