CAS 17606-72-3: Maltulose
Description:Maltulose is a disaccharide sugar composed of two glucose units linked by an α(1→4) glycosidic bond. It is a reducing sugar, which means it can participate in redox reactions, typically exhibiting a sweet taste. Maltulose is formed during the enzymatic breakdown of starch and is commonly found in certain food products, particularly in malted foods and beverages. Its molecular formula is C12H22O11, and it has a molecular weight of approximately 342.30 g/mol. Maltulose is known for its low glycemic index, making it a suitable alternative sweetener for individuals managing blood sugar levels. Additionally, it is less fermentable by yeast compared to other sugars, which can influence its use in food and beverage applications. The substance is soluble in water, and its stability under various conditions makes it a valuable ingredient in the food industry. Overall, maltulose is recognized for its unique properties and potential health benefits, particularly in the context of dietary management.
Formula:C12H22O11
InChI:InChI=1S/C12H22O11/c13-1-4(16)7(18)11(5(17)2-14)23-12-10(21)9(20)8(19)6(3-15)22-12/h5-15,17-21H,1-3H2/t5-,6-,7-,8-,9+,10-,11-,12-/m1/s1
InChI key:InChIKey=PFCRQPBOOFTZGQ-RGXJTGTOSA-N
SMILES:O=C(CO)C(O)C(OC1OC(CO)C(O)C(O)C1O)C(O)CO
- Synonyms:
- 4-O--D-Glucopyranosyl-D-fructose monohydrate
- 4-O-alpha-D-glucopyranosyl-D-fructose
- 4-O-alpha-D-glucopyranosyl-alpha-D-fructopyranose
- 4-O-α-<span class="text-smallcaps">D</smallcap>-Glucopyranosyl-<smallcap>D</span>-fructose
- <span class="text-smallcaps">D</smallcap>-Fructose, 4-O-α-<smallcap>D</span>-glucopyranosyl-
- Fructose, 4-O-α-<span class="text-smallcaps">D</smallcap>-glucopyranosyl-, <smallcap>D</span>-
- Maltulose
- D-Fructose, 4-O-α-D-glucopyranosyl-
- 4-O-α-D-Glucopyranosyl-D-fructose
- Fructose, 4-O-α-D-glucopyranosyl-, D-
- See more synonyms
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | D-Fructose, 4-O-α-D-glucopyranosyl- REF: IN-DA0021F7CAS: 17606-72-3 | 98% | To inquire | Thu 27 Mar 25 |
![]() | Maltulose monohydrate REF: 7W-GC3593CAS: 17606-72-3 | ≥ 95.0% | To inquire | Fri 28 Mar 25 |

D-Fructose, 4-O-α-D-glucopyranosyl-
Ref: IN-DA0021F7
1g | To inquire | ||
100mg | 183.00 € | ||
250mg | 457.00 € |

Maltulose monohydrate
Ref: 7W-GC3593
Undefined size | To inquire |