CAS 17608-59-2: α-[1-(Methylnitrosoamino)ethyl]benzenemethanol

Description:α-[1-(Methylnitrosoamino)ethyl]benzenemethanol, with CAS number 17608-59-2, is a chemical compound that belongs to the class of nitrosamines, which are known for their potential carcinogenic properties. This compound features a complex structure that includes a nitroso group, which is characteristic of nitrosamines, and a phenolic moiety due to the benzenemethanol component. The presence of the methylnitrosoamino group suggests that it may participate in various chemical reactions, including those that lead to the formation of DNA adducts, which are critical in the study of cancer biology. The compound is typically studied in the context of its biological effects, particularly its mutagenic and carcinogenic potential. Additionally, due to its structural characteristics, it may exhibit solubility in organic solvents and could be involved in various chemical interactions. Safety precautions are essential when handling this compound, given its association with health risks. Overall, α-[1-(Methylnitrosoamino)ethyl]benzenemethanol serves as an important subject of research in toxicology and environmental chemistry.

Formula:C₁₀H₁₄N₂O₂

InChI:InChI=1S/C10H14N2O2/c1-8(12(2)11-14)10(13)9-6-4-3-5-7-9/h3-8,10,13H,1-2H3

InChI key:InChIKey=ZVTOLKAVCZXHFM-UHFFFAOYSA-N

SMILES:O=NN(C)C(C)C(O)C=1C=CC=CC1

Synonyms:
2-[Methyl(nitroso)amino]-1-phenyl-1-propanol
Benzyl alcohol, α-[1-(methylnitrosamino)ethyl]-
N-Nitrosoephedrine
α-[1-(Methylnitrosoamino)ethyl]benzenemethanol
Benzenemethanol, α-[1-(methylnitrosoamino)ethyl]-

Found 3 products.

Product data	Purity	Price range	Estimated delivery
N-Nitroso rac-Ephedrine and N-Nitroso rac-Pseudoephedrine REF: 4Z-E-128023CAS: 17608-59-2	- - -	To inquire	Fri 28 Mar 25
N-Nitrosoephedrine REF: TR-N137360CAS: 17608-59-2	- - -	296.00 €~2,056.00 €	Tue 08 Apr 25
2-[Methyl(nitroso)amino]-1-phenylpropan-1-ol REF: 3D-SAA60859CAS: 17608-59-2	Min. 95%	- - -	Discontinued product