CAS 17632-18-7: 2,3,7,8,12,13,17,18-octaethyl-21H,23H-porphine zi
Description:2,3,7,8,12,13,17,18-octaethyl-21H,23H-porphine zinc (often abbreviated as ZnOEP) is a synthetic porphyrin compound characterized by its complex cyclic structure, which includes a central zinc ion coordinated to a porphyrin ring. This compound features eight ethyl substituents at the 2, 3, 7, 8, 12, 13, 17, and 18 positions of the porphyrin, enhancing its solubility in organic solvents and contributing to its unique optical properties. ZnOEP exhibits strong absorption in the visible region of the electromagnetic spectrum, making it useful in various applications, including photodynamic therapy, solar energy conversion, and as a dye in organic electronics. The presence of the zinc ion not only stabilizes the porphyrin structure but also plays a crucial role in its electronic properties, allowing for efficient electron transfer processes. Additionally, ZnOEP can participate in coordination chemistry, forming complexes with various ligands, which further expands its utility in research and industrial applications.
Formula:C36H46N4Zn
InChI:InChI=1S/C36H44N4.Zn/c1-9-21-22(10-2)30-18-32-25(13-5)26(14-6)34(39-32)20-36-28(16-8)27(15-7)35(40-36)19-33-24(12-4)23(11-3)31(38-33)17-29(21)37-30;/h17-20H,9-16H2,1-8H3;/q-2;+2/b29-17-,30-18-,31-17?,32-18?,33-19-,34-20-,35-19?,36-20?;
InChI key:InChIKey=VVUVWOLOUOYXOI-RNUBSZNLSA-N
SMILES:C=1C=2C(=C(C3=CC4=C(C(=C5C=C6C(=C(C=7C=C8C(=C(C1[N-]8[Zn+2]([N]23)([N]76)[N-]45)CC)CC)CC)CC)CC)CC)CC)CC
- Synonyms:
- (2,3,7,8,12,13,17,18-Octaethylporphyrinato)zinc
- (Octaethylporphinato)zinc
- (Octaethylporphyrin)zinc
- (Octaethylporphyrinato)zinc
- (SP-4-1)-[2,3,7,8,12,13,17,18-Octaethyl-21H,23H-porphinato(2-)-κN<sup>21</sup>,κN<sup>22</sup>,κN<sup>23</sup>,κN<sup>24</sup>]zinc
- 2,3,7,8,12,13,17,18-Octaethyl-21H,23H-porphinatozinc
- 2,3,7,8,12,13,17,18-Octaethyl-21H,23H-porphine zinc(II)
- 21H,23H-Porphine, 2,3,7,8,12,13,17,18-octaethyl-, zinc complex
- 21H,23H-Porphine, zinc deriv.
- Zinc octaethylporphine
- See more synonyms
- Zinc octaethylporphyrin
- Zinc, [2,3,7,8,12,13,17,18-octaethyl-21H,23H-porphinato(2-)-N<sup>21</sup>,N<sup>22</sup>,N<sup>23</sup>,N<sup>24</sup>]-, (SP-4-1)-
- Zinc, [2,3,7,8,12,13,17,18-octaethyl-21H,23H-porphinato(2-)-κN<sup>21</sup>,κN<sup>22</sup>,κN<sup>23</sup>,κN<sup>24</sup>]-, (SP-4-1)-
- Zinc, [2,3,7,8,12,13,17,18-octaethylporphinato(2-)]-
- β-Octaethylporphyrinatozinc
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Zn(II) Octaethylporphine REF: FT-O40938CAS: 17632-18-7 | >95% | To inquire | Tue 01 Apr 25 |

Ref: FT-O40938
1g | To inquire | ||
100mg | 115.00 € | ||
250mg | To inquire | ||
500mg | To inquire |