CAS 17737-65-4: Clonixin
Description:Clonixin, with the CAS number 17737-65-4, is a non-steroidal anti-inflammatory drug (NSAID) primarily used for its analgesic and anti-inflammatory properties. It is characterized by its ability to inhibit the cyclooxygenase (COX) enzymes, which play a crucial role in the synthesis of prostaglandins, compounds involved in inflammation and pain signaling. Clonixin is typically administered in the form of its sodium salt and is known for its effectiveness in treating conditions such as pain and inflammation associated with various disorders. The substance is generally well-absorbed when taken orally, and its pharmacokinetics involve metabolism in the liver, with excretion primarily through the kidneys. Clonixin may exhibit side effects common to NSAIDs, including gastrointestinal discomfort and potential renal effects, necessitating caution in patients with pre-existing conditions. Its chemical structure includes a pyridine ring, contributing to its pharmacological activity. As with all medications, it is essential to use clonixin under medical supervision to ensure safety and efficacy.
Formula:C13H11ClN2O2
InChI:InChI=1S/C13H11ClN2O2/c1-8-10(14)5-2-6-11(8)16-12-9(13(17)18)4-3-7-15-12/h2-7H,1H3,(H,15,16)(H,17,18)
InChI key:InChIKey=CLOMYZFHNHFSIQ-UHFFFAOYSA-N
SMILES:O=C(O)C1=CC=CN=C1NC=2C=CC=C(Cl)C2C
- Synonyms:
- 2-(2-Methyl-3-chloroanilino)nicotinic acid
- 2-(2′-Methyl-3′-chloro)-anilinonicotinic acid
- 2-(3-Chloro-2-methylanilino)-3-pyridinecarboxylic acid
- 2-(3-Chloro-2-methylanilino)nicotinic acid
- 2-[(3-Chloro-2-Methylphenyl)Amino]Pyridine-3-Carboxylic Acid
- 2-[(3-Chloro-2-methylphenyl)amino]-3-pyridinecarboxylic acid
- 3-Pyridinecarboxylic acid, 2-[(3-chloro-2-methylphenyl)amino]-
- Cba 93626
- Chlonixin
- Clonixic acid
- See more synonyms
- Clonixine
- NSC 335505
- Nicotinic acid, 2-(3-chloro-o-toluidino)-
- Sch 10304
- Clonixin
![3-Pyridinecarboxylic acid, 2-[(3-chloro-2-methylphenyl)amino]-](https://static.cymitquimica.com/products/IN/thumb/DA0025A5.jpg)
