CAS 1775-43-5: (Z)-3-Hexenoic acid

Description:(Z)-3-Hexenoic acid, with the CAS number 1775-43-5, is an unsaturated fatty acid characterized by a double bond between the third and fourth carbon atoms in its carbon chain, which is in the Z (cis) configuration. This configuration influences its physical and chemical properties, including its reactivity and boiling point. The molecular formula of (Z)-3-Hexenoic acid is C6H10O2, indicating the presence of a carboxylic acid functional group, which contributes to its acidity and solubility in polar solvents like water. This compound typically appears as a colorless to pale yellow liquid with a characteristic odor. It is used in various applications, including flavoring and fragrance industries, and may also serve as an intermediate in organic synthesis. The presence of the double bond makes it more reactive than saturated fatty acids, allowing for various chemical transformations. Additionally, (Z)-3-Hexenoic acid can participate in reactions such as hydrogenation and polymerization, further expanding its utility in chemical processes.

Formula:C₆H₁₀O₂

InChI:InChI=1S/C6H10O2/c1-2-3-4-5-6(7)8/h3-4H,2,5H2,1H3,(H,7,8)/b4-3-

InChI key:InChIKey=XXHDAWYDNSXJQM-ARJAWSKDSA-N

SMILES:O=C(O)CC=CCC

Found 2 products.

Brand	Product data	Purity	Price range	Estimated delivery
	3-Hexenoic acid, (3Z)- REF: IN-DA0025CZCAS: 1775-43-5	95%	To inquire	Thu 27 Mar 25
	cis-3-Hexenoic Acid REF: 4Z-H-076004CAS: 1775-43-5	- - -	To inquire	Thu 03 Apr 25