CAS 177734-81-5: Methyl 3-(hydroxymethyl)-5-iodobenzoate

Description:Methyl 3-(hydroxymethyl)-5-iodobenzoate is an organic compound characterized by its aromatic structure, which includes a benzoate moiety substituted with both a hydroxymethyl group and an iodine atom. The presence of the hydroxymethyl group introduces a polar functional group, enhancing its solubility in polar solvents, while the iodine atom contributes to the compound's reactivity and potential applications in organic synthesis. This compound is typically used in medicinal chemistry and as an intermediate in the synthesis of various pharmaceuticals and agrochemicals. Its molecular structure suggests it may exhibit interesting biological activities, although specific biological properties would require further investigation. The compound's CAS number, 177734-81-5, allows for precise identification in chemical databases, facilitating research and development. Safety data should be consulted to understand its handling and potential hazards, as iodine-containing compounds can pose risks. Overall, Methyl 3-(hydroxymethyl)-5-iodobenzoate is a valuable compound in the field of organic chemistry with diverse applications.

Formula:C₉H₉IO₃

InChI:InChI=1S/C9H9IO3/c1-13-9(12)7-2-6(5-11)3-8(10)4-7/h2-4,11H,5H2,1H3

InChI key:InChIKey=APMFIBGELZJQQD-UHFFFAOYSA-N

SMILES:O=C(OC)C1=CC(I)=CC(=C1)CO

Synonyms:
Benzoic acid, 3-(hydroxymethyl)-5-iodo-, methyl ester
Methyl 3-(hydroxymethyl)-5-iodobenzoate
Methyl 5-(hydroxymethyl)-3-iodobenzoate

Found 2 products.

Brand	Product data	Purity	Price range	Estimated delivery
	Methyl 3-(hydroxymethyl)-5-iodobenzoate REF: 10-F785906CAS: 177734-81-5	98%	- - -	Discontinued product
	Methyl 3-(hydroxymethyl)-5-iodobenzoate REF: 3D-CHA73481CAS: 177734-81-5	Min. 95%	- - -	Discontinued product