CAS 1780-19-4: 2-Methyl-1,2,3,4-tetrahydroquinoline
Description:2-Methyl-1,2,3,4-tetrahydroquinoline is a bicyclic organic compound characterized by its fused ring structure, which includes a quinoline framework. It is a colorless to pale yellow liquid at room temperature and possesses a distinct aromatic odor. The compound is classified as a nitrogen-containing heterocycle, with a nitrogen atom incorporated into the ring system, contributing to its basicity and potential reactivity. Its molecular formula is C10H13N, indicating the presence of ten carbon atoms, thirteen hydrogen atoms, and one nitrogen atom. 2-Methyl-1,2,3,4-tetrahydroquinoline is soluble in organic solvents such as ethanol and ether but has limited solubility in water due to its hydrophobic nature. This compound is of interest in various fields, including medicinal chemistry, where it may serve as a precursor or intermediate in the synthesis of bioactive molecules. Additionally, it exhibits potential pharmacological properties, making it a subject of research for its applications in drug development. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C10H13N
InChI:InChI=1S/C10H13N/c1-8-6-7-9-4-2-3-5-10(9)11-8/h2-5,8,11H,6-7H2,1H3
InChI key:InChIKey=JZICUKPOZUKZLL-UHFFFAOYSA-N
SMILES:C=1C=CC2=C(C1)NC(C)CC2
- Synonyms:
- 1,2,3,4-Tetahydro-2-methylquinoline
- 1,2,3,4-Tetrahydro-2-methylquinoline
- 1,2,3,4-Tetrahydroquinaldine
- Ai3-15932
- Nsc 65607
- Quinaldine, 1,2,3,4-tetrahydro-
- Quinaldine, 1,2,3,4-tetrahydro- (8CI)
- Quinoline, 1,2,3,4-tetrahydro-2-methyl-
- Quinoline, 1,2,3,4-tetrahydro-2-methyl- (9CI)
- 2-Methyl-1,2,3,4-tetrahydroquinoline
- See more synonyms
