CAS 17869-77-1: [(1,1-Dimethyl-2-propyn-1-yl)oxy]trimethylsilane
Description:[(1,1-Dimethyl-2-propyn-1-yl)oxy]trimethylsilane, with the CAS number 17869-77-1, is an organosilicon compound characterized by the presence of a trimethylsilyl group attached to an alkoxy functional group derived from a propyne derivative. This compound typically exhibits properties common to silanes, such as low volatility and reactivity, particularly in the presence of moisture, which can lead to hydrolysis and the formation of silanol groups. It is often used as a reagent in organic synthesis and as a protective group in various chemical reactions due to its ability to stabilize reactive intermediates. The presence of the alkynyl group may impart unique reactivity, making it useful in coupling reactions or as a precursor for further functionalization. Additionally, its structure suggests potential applications in materials science, particularly in the development of siloxane-based polymers or coatings. Safety data should be consulted for handling and storage, as organosilicon compounds can pose health and environmental risks.
Formula:C8H16OSi
InChI:InChI=1S/C8H16OSi/c1-7-8(2,3)9-10(4,5)6/h1H,2-6H3
InChI key:InChIKey=JNRUXZIXAXHXTN-UHFFFAOYSA-N
SMILES:C#CC(O[Si](C)(C)C)(C)C
- Synonyms:
- ((1,1-Dimethyl-2-Propynyl)Oxy)Trimethyl-Silane
- (1,1-Dimethyl-2-propynyloxy)trimethylsilane
- (2-Methyl-3-butyn-2-yloxy)trimethylsilane
- 1,1-Dimethylpropargyl trimethylsilyl ether
- 3-Methyl-1-butyn-3-yl trimethylsilyl ether
- 3-Methyl-3-(trimethylsiloxy)-1-butyne
- Silane, [(1,1-dimethyl-2-propyn-1-yl)oxy]trimethyl-
- Silane, [(1,1-dimethyl-2-propynyl)oxy]trimethyl-
- Trimethyl(1,1-dimethyl-2-propynyloxy)silane
- Trimethyl(2-methyl-3-butyn-2-yloxy)silane
- See more synonyms
- Trimethyl[(2-Methylbut-3-Yn-2-Yl)Oxy]Silane
- [(1,1-Dimethyl-2-propyn-1-yl)oxy]trimethylsilane
- [(1,1-Dimethyl-2-propynyl)oxy]trimethylsilane

3-Methyl-3-trimethylsiloxy-1-butyne, 97%
Ref: 02-043922
10g | 105.00 € | ||
50g | 389.00 € |

Silane, [(1,1-dimethyl-2-propyn-1-yl)oxy]trimethyl-
Ref: IN-DA002692
Undefined size | To inquire |

Ref: 54-OR1008851
5ml | 133.00 € | ||
25ml | 321.00 € | ||
100ml | 1,155.00 € |

3-Methyl-3-trimethylsilyloxy-1-butyne
Ref: 10-S11990
2g | To inquire |

[(1,1-Dimethyl-2-propynyl)oxy]trimethylsilane
Ref: 3D-FD30935
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
25g | Discontinued | Request information | |
50g | Discontinued | Request information | |
100g | Discontinued | Request information |