CAS 1788044-08-5: Acetamide, N-(3-bromo-1-methyl-1H-indazol-5-yl)-

Description:Acetamide, N-(3-bromo-1-methyl-1H-indazol-5-yl)- is a chemical compound characterized by its acetamide functional group attached to a substituted indazole moiety. The presence of the bromine atom at the 3-position of the indazole ring contributes to its reactivity and potential biological activity. This compound typically exhibits properties associated with both amides and heterocyclic compounds, such as moderate solubility in polar solvents and the ability to participate in hydrogen bonding due to the amide group. The indazole structure may impart unique pharmacological properties, making it of interest in medicinal chemistry. Additionally, the presence of the methyl group at the 1-position of the indazole can influence the compound's steric and electronic properties, potentially affecting its interactions with biological targets. Overall, this compound's characteristics suggest it may be useful in various applications, including drug development and research into new therapeutic agents.

Formula:C₁₀H₁₀BrN₃O

InChI:InChI=1S/C10H10BrN3O/c1-6(15)12-7-3-4-9-8(5-7)10(11)13-14(9)2/h3-5H,1-2H3,(H,12,15)

InChI key:InChIKey=FWTKOIFMPFDQKE-UHFFFAOYSA-N

SMILES:O=C(NC=1C=CC2=C(C1)C(Br)=NN2C)C

Found 4 products.

Product data	Purity	Price range	Estimated delivery
n-(3-bromo-1-methyl-1h-indazol-5-yl)acetamide REF: IN-DA00ILE8CAS: 1788044-08-5	97%	To inquire	Thu 27 Mar 25
N-(3-Bromo-1-methyl-1H-indazol-5-yl)acetamide REF: 10-F609407CAS: 1788044-08-5	97%	To inquire	Tue 08 Apr 25
n-(3-bromo-1-methy-1h-indazol-5-yl)acetamide REF: 10-F517270CAS: 1788044-08-5	95	- - -	Discontinued product
n-(3-Bromo-1-methyl-1h-indazol-5-yl)acetamide REF: 3D-NWC04408CAS: 1788044-08-5	Min. 95%	- - -	Discontinued product