CAS 17887-41-1: [Dichloro(1,1-dimethylethyl)silyl]benzene

Description:Dichloro(1,1-dimethylethyl)silylbenzene, with the CAS number 17887-41-1, is an organosilicon compound characterized by the presence of a silicon atom bonded to two chlorine atoms and a benzene ring substituted with a tert-butyl group (1,1-dimethylethyl group). This compound typically exhibits properties associated with both organic and inorganic chemistry due to its silicon content. It is likely to be a colorless to pale yellow liquid or solid, depending on its specific form and purity. The presence of chlorine atoms suggests that it may be reactive, particularly in nucleophilic substitution reactions. The tert-butyl group contributes to steric hindrance, which can influence the reactivity and stability of the compound. Additionally, the compound may have applications in materials science, particularly in the synthesis of silicone polymers or as a precursor in various chemical reactions. Safety precautions should be observed when handling this compound, as it may pose health risks due to its chlorinated nature.

Formula:C₁₀H₁₄Cl₂Si

InChI:InChI=1S/C10H14Cl2Si/c1-10(2,3)13(11,12)9-7-5-4-6-8-9/h4-8H,1-3H3

InChI key:InChIKey=OCXPCSGIIJESOA-UHFFFAOYSA-N

SMILES:Cl[Si](Cl)(C=1C=CC=CC1)C(C)(C)C

Synonyms:
Benzene, [dichloro(1,1-dimethylethyl)silyl]-
Silane, dichloro(1,1-dimethylethyl)phenyl-
Silane, tert-butyldichlorophenyl-
[Dichloro(1,1-dimethylethyl)silyl]benzene
tert-Butyldichlorophenylsilane
tert-Butylphenyldichlorosilane

Found 3 products.

Product data	Purity	Price range	Estimated delivery
tert-Butyldichloro(phenyl)silane REF: 3B-B5314CAS: 17887-41-1	>95.0%(GC)	94.00 €	Thu 20 Mar 25
Benzene, [dichloro(1,1-dimethylethyl)silyl]- REF: IN-DA0026FDCAS: 17887-41-1	95.0%	To inquire	Thu 27 Mar 25
tert-Butyldichloro(phenyl)silane REF: 3D-SAA88741CAS: 17887-41-1	Min. 95%	- - -	Discontinued product