CAS 178974-98-6: 2,4-Difluoro-3-methoxybenzenemethanol

Description:2,4-Difluoro-3-methoxybenzenemethanol, with the CAS number 178974-98-6, is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with two fluorine atoms and a methoxy group, along with a hydroxymethyl group. The presence of the difluoro substituents typically enhances the compound's lipophilicity and may influence its reactivity and biological activity. The methoxy group contributes to the compound's overall polarity and can participate in hydrogen bonding, affecting solubility in various solvents. This compound may exhibit interesting pharmacological properties due to its structural features, making it a subject of interest in medicinal chemistry. Additionally, the specific arrangement of substituents can lead to unique electronic properties, potentially impacting its behavior in chemical reactions. As with many fluorinated compounds, it may also exhibit stability against metabolic degradation, which is a valuable trait in drug design. Overall, 2,4-Difluoro-3-methoxybenzenemethanol represents a complex molecule with potential applications in various fields, including pharmaceuticals and agrochemicals.

Formula:C₈H₈F₂O₂

InChI:InChI=1S/C8H8F2O2/c1-12-8-6(9)3-2-5(4-11)7(8)10/h2-3,11H,4H2,1H3

InChI key:InChIKey=QTCZZZXJIWXQHL-UHFFFAOYSA-N

SMILES:FC1=CC=C(C(F)=C1OC)CO

Synonyms:
2,4-Difluoro-3-methoxybenzyl alcohol
Benzenemethanol, 2,4-difluoro-3-methoxy-
(2,4-Difluoro-3-methoxyphenyl)methanol
2,4-Difluoro-3-methoxybenzenemethanol

Found 3 products.

Product data	Purity	Price range	Estimated delivery
2,4-Difluoro-3-methoxybenzyl alcohol REF: 54-PC302663CAS: 178974-98-6	97%	93.00 €~264.00 €	Thu 03 Apr 25
2,4-Difluoro-3-methoxybenzyl alcohol REF: 10-F342393CAS: 178974-98-6	- - -	- - -	Discontinued product
2,4-Difluoro-3-methoxybenzyl alcohol REF: 3D-DHA97498CAS: 178974-98-6	Min. 95%	- - -	Discontinued product