CAS 179688-54-1: 4-Chloro-6-acetoxy-7-methoxyquinazoline hydrochloride
Description:4-Chloro-6-acetoxy-7-methoxyquinazoline hydrochloride is a synthetic chemical compound belonging to the quinazoline class, which is characterized by a bicyclic structure containing a benzene ring fused to a pyrimidine ring. This compound features a chloro substituent at the 4-position, an acetoxy group at the 6-position, and a methoxy group at the 7-position of the quinazoline ring, contributing to its unique chemical properties and potential biological activities. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which can enhance its bioavailability for pharmaceutical applications. The presence of these functional groups suggests potential interactions with biological targets, making it of interest in medicinal chemistry, particularly in the development of therapeutic agents. Its specific characteristics, such as melting point, solubility, and reactivity, would depend on the conditions under which it is studied or utilized. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.
Formula:C11H10Cl2N2O3
InChI:InChI=1/C11H9ClN2O3.ClH/c1-6(15)17-10-3-7-8(4-9(10)16-2)13-5-14-11(7)12;/h3-5H,1-2H3;1H
- Synonyms:
- 6-Quinazolinol, 4-chloro-7-methoxy-, 6-acetate, hydrochloride (1:1)
- 4-Chloro-7-methoxyquinazolin-6-yl acetate monohydrochloride
- 4-Chloro-7-Methoxyquinazolin-6-Yl Acetate Hydrochloride (1:1)
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | 6-Quinazolinol, 4-chloro-7-methoxy-, 6-acetate, hydrochloride (1:1) REF: IN-DA00276XCAS: 179688-54-1 | 97% | 55.00 €~187.00 € | Thu 27 Mar 25 |
 | 4-Chloro-7-methoxyquinazolin-6-yl acetate hydrochloride REF: 10-F723466CAS: 179688-54-1 | 95% | To inquire | Tue 08 Apr 25 |
 | 4-Chloro-7-methoxyquinazolin-6-yl acetate HCl REF: 3D-EHA68854CAS: 179688-54-1 | Min. 95% | - - - | Discontinued product |
6-Quinazolinol, 4-chloro-7-methoxy-, 6-acetate, hydrochloride (1:1)
Ref: IN-DA00276X
| 1g | 187.00 € | ||
| 50mg | 55.00 € | ||
| 250mg | 63.00 € |
4-Chloro-7-methoxyquinazolin-6-yl acetate hydrochloride
Ref: 10-F723466
| 50mg | To inquire | ||
| 250mg | To inquire |
4-Chloro-7-methoxyquinazolin-6-yl acetate HCl
Ref: 3D-EHA68854
| 1g | Discontinued | Request information | |
| 5g | Discontinued | Request information | |
| 10g | Discontinued | Request information | |
| 250mg | Discontinued | Request information | |
| 500mg | Discontinued | Request information |
