CAS 179692-09-2: 1H-Pyrazole-3-carboxylicacid,4-formyl-,ethylester(9CI)
Description:1H-Pyrazole-3-carboxylic acid, 4-formyl-, ethyl ester, with the CAS number 179692-09-2, is an organic compound characterized by its pyrazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. This substance features a carboxylic acid group and an ethyl ester functional group, contributing to its reactivity and solubility properties. The presence of the formyl group indicates that it can participate in various chemical reactions, such as condensation and oxidation. Typically, compounds of this nature are of interest in medicinal chemistry and agrochemicals due to their potential biological activities. They may exhibit properties such as anti-inflammatory, antimicrobial, or antitumor effects, making them valuable in drug development. Additionally, the ethyl ester moiety enhances lipophilicity, which can influence the compound's absorption and distribution in biological systems. Overall, 1H-Pyrazole-3-carboxylic acid, 4-formyl-, ethyl ester is a versatile compound with potential applications in various fields of chemistry and pharmacology.
Formula:C7H8N2O3
InChI:InChI=1/C7H8N2O3/c1-2-12-7(11)6-5(4-10)3-8-9-6/h3-4H,2H2,1H3,(H,8,9)
- Synonyms:
- ethyl 4-formyl-1H-pyrazole-3-carboxylate
