CAS 1799420-91-9: Methyl 3,8-dibromo-5-fluoro-6-quinolineacetate
Description:Methyl 3,8-dibromo-5-fluoro-6-quinolineacetate is a synthetic organic compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom. This substance features multiple halogen substituents, specifically bromine and fluorine, which can significantly influence its chemical reactivity and biological activity. The presence of the methyl ester group indicates that it can undergo hydrolysis to release the corresponding acid, which may have implications for its solubility and reactivity in various environments. The compound's unique structure may confer specific pharmacological properties, making it of interest in medicinal chemistry, particularly in the development of new therapeutic agents. Additionally, the bromine and fluorine atoms can enhance lipophilicity, potentially affecting the compound's absorption and distribution in biological systems. Overall, Methyl 3,8-dibromo-5-fluoro-6-quinolineacetate represents a complex molecule with potential applications in drug discovery and development, warranting further investigation into its properties and effects.
Formula:C12H8Br2FNO2
InChI:InChI=1S/C12H8Br2FNO2/c1-18-10(17)3-6-2-9(14)12-8(11(6)15)4-7(13)5-16-12/h2,4-5H,3H2,1H3
InChI key:InChIKey=LMWDEGNGKHGSGL-UHFFFAOYSA-N
SMILES:O=C(OC)CC1=CC(Br)=C2N=CC(Br)=CC2=C1F
- Synonyms:
- Methyl 3,8-dibromo-5-fluoro-6-quinolineacetate
- 6-Quinolineacetic acid, 3,8-dibromo-5-fluoro-, methyl ester
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | Methyl 2-(3,8-dibromo-5-fluoroquinolin-6-yl)acetate REF: IN-DA00HZZFCAS: 1799420-91-9 | - - - | To inquire | Thu 27 Mar 25 |
 | METHYL 2-(3,8-DIBROMO-5-FLUOROQUINOLIN-6-YL)ACETATE REF: 10-F386521CAS: 1799420-91-9 | 95.0% | - - - | Discontinued product |
 | Methyl 2-(3,8-dibromo-5-fluoroquinolin-6-yl)acetate REF: 3D-ZWC42091CAS: 1799420-91-9 | Min. 95% | - - - | Discontinued product |
Methyl 2-(3,8-dibromo-5-fluoroquinolin-6-yl)acetate
Ref: IN-DA00HZZF
| Undefined size | To inquire |
METHYL 2-(3,8-DIBROMO-5-FLUOROQUINOLIN-6-YL)ACETATE
Ref: 10-F386521
| 1g | Discontinued | Request information | |
| 100mg | Discontinued | Request information | |
| 250mg | Discontinued | Request information |
Methyl 2-(3,8-dibromo-5-fluoroquinolin-6-yl)acetate
Ref: 3D-ZWC42091
| 25mg | Discontinued | Request information | |
| 50mg | Discontinued | Request information | |
| 100mg | Discontinued | Request information | |
| 250mg | Discontinued | Request information | |
| 500mg | Discontinued | Request information |
