CAS 18002-26-1: 1-(tetrahydrofuran-2-yl)pyrimidine-2,4(1H,3H)-dione

Description: 1-(Tetrahydrofuran-2-yl)pyrimidine-2,4(1H,3H)-dione, with the CAS number 18002-26-1, is a heterocyclic organic compound characterized by its pyrimidine core, which is a six-membered ring containing two nitrogen atoms at positions 2 and 4. This compound features a tetrahydrofuran moiety, a five-membered cyclic ether, which contributes to its structural complexity and potential reactivity. The presence of the dione functional groups indicates that it contains two carbonyl (C=O) groups, which can participate in various chemical reactions, such as nucleophilic additions or condensation reactions. The compound is likely to exhibit polar characteristics due to the electronegative nitrogen and oxygen atoms, influencing its solubility in polar solvents. Additionally, the structural features suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, owing to the biological activity often associated with pyrimidine derivatives. Overall, this compound's unique structure and functional groups make it a subject of interest in organic synthesis and drug discovery.

Formula: C₈H₁₀N₂O₃

InChI: InChI=1S/C8H10N2O3/c11-6-3-4-10(8(12)9-6)7-2-1-5-13-7/h3-4,7H,1-2,5H2,(H,9,11,12)

InChI key: InChIKey=CWWIKVUHBBTKHC-UHFFFAOYSA-N

SMILES: O=C1C=CN(C(=O)N1)C2OCCC2

2,4(1H,3H)-Pyrimidinedione, 1-(tetrahydro-2-furanyl)-

CAS: 18002-26-1

• Formula: C₈H₁₀N₂O₃
• Purity: 95%
• Molecular weight: 182.1766

Tetrahydrofuryluracil

CAS: 18002-26-1

• Formula: C₈H₁₀N₂O₃
• Molecular weight: 182.18