CAS 18042-54-1: Silanetriol, 1-phenyl-, 1,1,1-triacetate

Description:Silanetriol, 1-phenyl-, 1,1,1-triacetate, with the CAS number 18042-54-1, is an organosilicon compound characterized by the presence of a silicon atom bonded to three acetoxy groups and a phenyl group. This compound typically exhibits properties associated with silanes, such as low volatility and potential reactivity with moisture, leading to the formation of silanol groups. Its structure suggests that it may have applications in various fields, including materials science and organic synthesis, particularly in the development of silane-based coatings or as a coupling agent in polymer chemistry. The presence of the phenyl group can impart unique electronic and steric properties, potentially enhancing its reactivity or stability in certain chemical environments. Additionally, the acetoxy groups may facilitate further chemical modifications or reactions, making this compound versatile in synthetic applications. As with many organosilicon compounds, safety considerations should be taken into account, particularly regarding its handling and potential reactivity with water or other nucleophiles.

Formula:C₁₂H₁₄O₆Si

InChI:InChI=1S/C12H14O6Si/c1-9(13)16-19(17-10(2)14,18-11(3)15)12-7-5-4-6-8-12/h4-8H,1-3H3

InChI key:InChIKey=VLFKGWCMFMCFRM-UHFFFAOYSA-N

SMILES:O=C(O[Si](OC(=O)C)(OC(=O)C)C=1C=CC=CC1)C

Synonyms:
Monophenyltriacetoxysilane
Phenylsilanetriyl Triacetate
Silanetriol, 1-phenyl-, 1,1,1-triacetate
Silanetriol, phenyl-, triacetate
Triacetoxyphenylsilane
[Diacetyloxy(phenyl)silyl] acetate
Phenyltriacetoxysilane

Found 3 products.

Product data	Purity	Price range	Estimated delivery
Silanetriol, 1-phenyl-, 1,1,1-triacetate REF: IN-DA0021ZTCAS: 18042-54-1	- - -	To inquire	Thu 27 Mar 25
Phenyltriacetoxysilane REF: 10-S13650CAS: 18042-54-1	- - -	- - -	Discontinued product
PHENYLTRIACETOXYSILANE, tech-90 REF: 3H-SIP6790.0CAS: 18042-54-1	90%	- - -	Discontinued product