CAS 1808-26-0: Ethyl arachidonate
Description:Ethyl arachidonate is an ester derived from arachidonic acid and ethanol, classified as a fatty acid ester. It is a colorless to pale yellow liquid at room temperature and is insoluble in water but soluble in organic solvents such as ethanol and chloroform. Ethyl arachidonate is notable for its role in biological systems, particularly in the context of lipid metabolism and cellular signaling. It serves as a precursor for various bioactive lipids, including eicosanoids, which are involved in inflammatory responses and other physiological processes. The compound has a relatively high boiling point due to its long hydrocarbon chain, and it exhibits properties typical of fatty acid esters, such as being non-toxic and having low volatility. Ethyl arachidonate is used in research settings to study lipid metabolism and cellular signaling pathways, and it may also have applications in the food and cosmetic industries due to its emollient properties. As with many esters, it can undergo hydrolysis in the presence of water or enzymes, reverting to its constituent fatty acid and alcohol.
Formula:C22H36O2
InChI:InChI=1S/C22H36O2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24-4-2/h8-9,11-12,14-15,17-18H,3-7,10,13,16,19-21H2,1-2H3/b9-8-,12-11-,15-14-,18-17-
InChI key:InChIKey=SNXPWYFWAZVIAU-GKFVBPDJSA-N
SMILES:O=C(OCC)CCCC=CCC=CCC=CCC=CCCCCC
- Synonyms:
- 5,8,11,14-Eicosatetraenoic acid, ethyl ester, (5Z,8Z,11Z,14Z)-
- 5,8,11,14-Eicosatetraenoic acid, ethyl ester, (all-Z)-
- Arachidonic Acid Ethyl Ester
- Archionic acid ethylester
- Ethyl arachidonate
- Immunocytophyt
- ethyl (5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoate
