CAS 18087-62-2: 2,2,2-Trifluoro-1-(1-methyl-1H-pyrrol-2-yl)ethanone
Description:2,2,2-Trifluoro-1-(1-methyl-1H-pyrrol-2-yl)ethanone, with the CAS number 18087-62-2, is a chemical compound characterized by its unique structure that includes a trifluoroacetyl group and a pyrrole moiety. This compound is typically a colorless to pale yellow liquid, exhibiting a distinct odor. It is known for its high reactivity due to the presence of the trifluoromethyl group, which can influence its chemical behavior and interactions. The trifluoromethyl group enhances the compound's lipophilicity and stability, making it useful in various synthetic applications, particularly in medicinal chemistry and agrochemicals. Additionally, the pyrrole ring contributes to its biological activity, as pyrrole derivatives are often found in pharmaceuticals. The compound is soluble in organic solvents, but its solubility in water is limited. Safety precautions should be taken when handling this substance, as it may pose health risks if inhaled or ingested. Overall, 2,2,2-Trifluoro-1-(1-methyl-1H-pyrrol-2-yl)ethanone is a valuable compound in chemical research and development.
Formula:C7H6F3NO
InChI:InChI=1S/C7H6F3NO/c1-11-4-2-3-5(11)6(12)7(8,9)10/h2-4H,1H3
InChI key:InChIKey=AASNHBHEKFWSAC-UHFFFAOYSA-N
SMILES:O=C(C1=CC=CN1C)C(F)(F)F
- Synonyms:
- Ethanone, 2,2,2-trifluoro-1-(1-methyl-1H-pyrrol-2-yl)-
- 2,2,2-Trifluoro-1-(1-methyl-1H-pyrrol-2-yl)ethanone
- Ketone, 1-methylpyrrol-2-yl trifluoromethyl
- 2,2,2-Trifluoro-1-(1-methyl-1H-pyrrol-2-yl)ethan-1-one
- 1-Methyl-2-trifluoroacetylpyrrole
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 2,2,2-Trifluoro-1-(1-methyl-1H-pyrrol-2-yl)ethanone REF: 54-PC300942CAS: 18087-62-2 | - - - | 125.00 €~535.00 € | Fri 28 Mar 25 |
![]() | 2,2,2-trifluoro-1-(1-methyl-1H-pyrrol-2-yl)ethanone REF: 10-F518526CAS: 18087-62-2 | - - - | - - - | Discontinued product |
![]() | 2,2,2-Trifluoro-1-(1-Methyl-1H-Pyrrol-2-Yl)Ethanone REF: 3D-FT92445CAS: 18087-62-2 | Min. 95% | - - - | Discontinued product |

2,2,2-Trifluoro-1-(1-methyl-1H-pyrrol-2-yl)ethanone
Ref: 54-PC300942
1g | 125.00 € | ||
5g | 341.00 € | ||
10g | 535.00 € |

2,2,2-trifluoro-1-(1-methyl-1H-pyrrol-2-yl)ethanone
Ref: 10-F518526
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10g | Discontinued | Request information |

2,2,2-Trifluoro-1-(1-Methyl-1H-Pyrrol-2-Yl)Ethanone
Ref: 3D-FT92445
1g | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |