CAS 181289-33-8: (R)-3-(Carbamoylmethyl)-5-methylhexanoic acid
Description:(R)-3-(Carbamoylmethyl)-5-methylhexanoic acid, with the CAS number 181289-33-8, is an amino acid derivative characterized by its unique structural features. This compound contains a hexanoic acid backbone, which is a six-carbon chain, with a carbamoylmethyl group and a methyl substituent at specific positions. The presence of the carbamoyl group indicates that it can participate in various chemical reactions, including amide bond formation. The (R) configuration denotes the specific stereochemistry at the chiral center, which can influence its biological activity and interactions. This compound is likely to be soluble in polar solvents due to the presence of both carboxylic acid and amide functional groups, which can engage in hydrogen bonding. Its potential applications may include use in pharmaceuticals, biochemistry, or as a building block in organic synthesis. Understanding its properties, such as melting point, solubility, and reactivity, is essential for its practical applications in research and industry.
Formula:C9H17NO3
InChI:InChI=1S/C9H17NO3/c1-6(2)3-7(4-8(10)11)5-9(12)13/h6-7H,3-5H2,1-2H3,(H2,10,11)(H,12,13)/t7-/m1/s1
InChI key:InChIKey=NPDKTSLVWGFPQG-SSDOTTSWSA-N
SMILES:O=C(O)CC(CC(=O)N)CC(C)C
- Synonyms:
- (3R)-3-(2-amino-2-oxoethyl)-5-methylhexanoic acid
- (R)-(-)-3-(2-Amino-2-Oxoethyl)-5-Methylhexanoic Acid
- (R)-(-)-3-Carbamoylmethyl-5-Methylhexanoic Acid
- Hexanoic acid, 3-(2-amino-2-oxoethyl)-5-methyl-, (R)-
- Hexanoic acid, 3-(2-amino-2-oxoethyl)-5-methyl-,(3R)-
- Intermediate Of Pregabalin
- R-3-(2-Amino-2-oxoethyl)-5-Methyl hexanoic Acid
