CAS 1818847-41-4: 7-Bromo-5-[(4-methylphenyl)sulfonyl]-5H-pyrrolo[2,3-b]pyrazine

Description: 7-Bromo-5-[(4-methylphenyl)sulfonyl]-5H-pyrrolo[2,3-b]pyrazine is a synthetic organic compound characterized by its complex heterocyclic structure, which includes a pyrrolo[2,3-b]pyrazine core. The presence of a bromine atom at the 7-position and a sulfonyl group attached to a 4-methylphenyl moiety at the 5-position contributes to its unique chemical properties. This compound is likely to exhibit significant biological activity, making it of interest in medicinal chemistry and drug development. Its sulfonyl group can enhance solubility and bioavailability, while the bromine atom may influence its reactivity and interaction with biological targets. The compound's molecular structure suggests potential applications in various fields, including pharmaceuticals and agrochemicals. Additionally, its synthesis and characterization would involve standard organic chemistry techniques, including NMR, mass spectrometry, and possibly X-ray crystallography for structural confirmation. Overall, 7-Bromo-5-[(4-methylphenyl)sulfonyl]-5H-pyrrolo[2,3-b]pyrazine represents a valuable compound for further research and development in chemical and biological sciences.

Formula: C₁₃H₁₀BrN₃O₂S

InChI: InChI=1S/C13H10BrN3O2S/c1-9-2-4-10(5-3-9)20(18,19)17-8-11(14)12-13(17)16-7-6-15-12/h2-8H,1H3

InChI key: InChIKey=RZIHFWIVUHARMG-UHFFFAOYSA-N

SMILES: O=S(=O)(C1=CC=C(C=C1)C)N2C=C(Br)C=3N=CC=NC32

Synonyms:

• 7-Bromo-5-[(4-methylphenyl)sulfonyl]-5H-pyrrolo[2,3-b]pyrazine
• 5H-Pyrrolo[2,3-b]pyrazine, 7-bromo-5-[(4-methylphenyl)sulfonyl]-
• 7-Bromo-5-(p-tolylsulfonyl)pyrrolo[2,3-b]pyrazine

5H-Pyrrolo[2,3-b]pyrazine, 7-bromo-5-[(4-methylphenyl)sulfonyl]-

CAS: 1818847-41-4

• Formula: C₁₃H₁₀BrN₃O₂S
• Molecular weight: 352.2064

7-BROMO-5-(4-METHYLBENZENESULFONYL)-5H-PYRROLO[2,3-B]PYRAZINE

CAS: 1818847-41-4

• Purity: 95.0%
• Molecular weight: 352.2099914550781

7-bromo-5-(4-methylbenzenesulfonyl)-5h-pyrrolo[2,3-b]pyrazine

CAS: 1818847-41-4

Versatile small molecule scaffold

• Formula: C₁₃H₁₀BrN₃O₂S
• Purity: Min. 95%
• Molecular weight: 352.21 g/mol