CAS 182008-07-7: 2,2-DIMETHOXY-1,6-DIAZA-2-SILACYCLOOCTANE

Description: 2,2-Dimethoxy-1,6-diaza-2-silacyclooctane is a chemical compound characterized by its unique structure, which includes a silacyclooctane ring integrated with nitrogen atoms and methoxy groups. The presence of two methoxy groups contributes to its potential reactivity and solubility in various organic solvents. The diaza substitution indicates that there are two nitrogen atoms incorporated into the cyclooctane framework, which can influence the compound's electronic properties and steric hindrance. This compound may exhibit interesting properties such as potential coordination capabilities with metal ions, making it relevant in coordination chemistry and materials science. Additionally, the silacycloalkane structure can impart unique stability and reactivity compared to its carbon-based counterparts. Its applications could extend to fields such as organic synthesis, catalysis, or as intermediates in the development of pharmaceuticals. However, specific applications and reactivity would depend on further empirical studies and characterization.

Formula: C₇H₁₈N₂O₂Si

InChI: InChI=1/C7H18N2O2Si/c1-10-12(11-2)7-3-4-8-5-6-9-12/h8-9H,3-7H2,1-2H3

Synonyms:

• 2,2-Dimethoxy-1,6,2-Diazasilocane

Silicon, dimethoxy[N1-(propyl-κC3)-1,2-ethanediaminato(2-)-κN1,κN2]-, (SP-5-12)-

CAS: 182008-07-7

• Formula: C₇H₁₈N₂O₂Si
• Molecular weight: 190.318g/mol

2,2-dimethoxy-1,6-diaza-2-silacyclooctane

CAS: 182008-07-7

S25352 - 2,2-dimethoxy-1,6-diaza-2-silacyclooctane

• Formula: C₇H₁₈N₂O₂Si
• Color and Shape: Solid
• Molecular weight: 190.3179931640625