CAS 1820684-04-5: 4-Bromo-2-(3-hydroxy-1-azetidinyl)-6-benzothiazolecarboxylic acid

Description: 4-Bromo-2-(3-hydroxy-1-azetidinyl)-6-benzothiazolecarboxylic acid is a chemical compound characterized by its complex structure, which includes a benzothiazole moiety, a bromine substituent, and an azetidine ring with a hydroxyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as potential biological activity due to the presence of the azetidine and hydroxyl functionalities. The bromine atom may influence its reactivity and solubility, while the carboxylic acid group can participate in hydrogen bonding and contribute to its acidity. The compound's unique structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, where it may act as a scaffold for further modifications. Additionally, its specific interactions with biological targets could be explored for therapeutic purposes. As with many such compounds, safety and handling precautions are essential due to the presence of halogens and the potential for biological activity.

Formula: C₁₁H₉BrN₂O₃S

InChI: InChI=1S/C11H9BrN2O3S/c12-7-1-5(10(16)17)2-8-9(7)13-11(18-8)14-3-6(15)4-14/h1-2,6,15H,3-4H2,(H,16,17)

InChI key: InChIKey=RXHGWZNASQPBLM-UHFFFAOYSA-N

SMILES: O=C(O)C=1C=C(Br)C=2N=C(SC2C1)N3CC(O)C3

Synonyms:

• 6-Benzothiazolecarboxylic acid, 4-bromo-2-(3-hydroxy-1-azetidinyl)-
• 4-Bromo-2-(3-hydroxy-1-azetidinyl)-6-benzothiazolecarboxylic acid

4-bromo-2-(3-hydroxyazetidin-1-yl)benzo[d]thiazole-6-carboxylic acid

CAS: 1820684-04-5

• Purity: 95.0%
• Molecular weight: 329.1700134277344

4-Bromo-2-(3-hydroxyazetidin-1-yl)benzo[D]thiazole-6-carboxylic acid

CAS: 1820684-04-5

Versatile small molecule scaffold

• Formula: C₁₁H₉BrN₂O₃S
• Purity: Min. 95%
• Molecular weight: 329.17 g/mol