CAS 1820687-50-0: 3-Chloro-7-isoquinolinemethanol
Description:3-Chloro-7-isoquinolinemethanol is a chemical compound characterized by its isoquinoline structure, which is a bicyclic aromatic compound. The presence of a chlorine atom at the 3-position and a hydroxymethyl group at the 7-position contributes to its unique reactivity and potential biological activity. This compound may exhibit properties typical of isoquinolines, such as being a potential pharmacophore in medicinal chemistry, where it could interact with various biological targets. Its solubility, stability, and reactivity can be influenced by the functional groups present, particularly the chlorine and hydroxymethyl groups. The compound's molecular interactions may also be affected by its stereochemistry and the spatial arrangement of its atoms. As with many organic compounds, safety and handling precautions are essential, as it may pose risks depending on its toxicity profile. Research into its applications could include areas such as drug development, where isoquinoline derivatives are often explored for their therapeutic potential.
Formula:C10H8ClNO
InChI:InChI=1S/C10H8ClNO/c11-10-4-8-2-1-7(6-13)3-9(8)5-12-10/h1-5,13H,6H2
InChI key:InChIKey=SJOKSEZKMUBNFY-UHFFFAOYSA-N
SMILES:ClC=1N=CC2=CC(=CC=C2C1)CO
- Synonyms:
- 7-Isoquinolinemethanol, 3-chloro-
- 3-Chloro-7-isoquinolinemethanol
(3-Chloroisoquinolin-7-yl)methanol
Ref: IN-DA00I0VL
| 100mg | 493.00 € |
Ref: FT-G14810
| 1g | To inquire | ||
| 250mg | To inquire |
Ref: 10-F604226
| 100mg | To inquire | ||
| 250mg | To inquire |
(3-Chloroisoquinolin-7-yl)methanol
Ref: 3D-VXC68750
| 10mg | 344.00 € | ||
| 25mg | 388.00 € | ||
| 50mg | 552.00 € |
