CAS 182181-38-0: 3-Fluoro-4-piperazinylbenzenecarbonitrile

Description:3-Fluoro-4-piperazinylbenzenecarbonitrile, with the CAS number 182181-38-0, is a chemical compound characterized by its structural features, which include a fluorine atom and a piperazine ring attached to a benzenecarbonitrile moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as moderate solubility in polar organic solvents and potential reactivity due to the presence of the nitrile functional group. The fluorine substituent can influence the compound's electronic properties, potentially enhancing its lipophilicity and biological activity. The piperazine ring contributes to the compound's ability to interact with biological targets, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Additionally, the presence of the carbonitrile group may impart specific reactivity patterns, allowing for further chemical modifications. Overall, 3-Fluoro-4-piperazinylbenzenecarbonitrile is a compound of interest in various fields, including drug discovery and materials science, due to its unique structural characteristics and potential applications.

Formula:C₁₁H₁₂FN₃

InChI:InChI=1/C11H12FN3/c12-10-7-9(8-13)1-2-11(10)15-5-3-14-4-6-15/h1-2,7,14H,3-6H2

Synonyms:
3-Fluoro-4-(piperazin-1-yl)benzonitrile
Benzonitrile, 3-fluoro-4-(1-piperazinyl)-

Found 5 products.

Product data	Purity	Price range	Estimated delivery
Benzonitrile, 3-fluoro-4-(1-piperazinyl)- REF: IN-DA0023GRCAS: 182181-38-0	95%	To inquire	Thu 27 Mar 25
3-Fluoro-4-(piperazin-1-yl)benzonitrile REF: 54-PC421125CAS: 182181-38-0	99+%	94.00 €~818.00 €	Fri 28 Mar 25
3-Fluoro-4-(piperazin-1-yl)benzonitrile REF: FT-F15560CAS: 182181-38-0	97%	To inquire	Tue 01 Apr 25
3-Fluoro-4-(piperazin-1-yl)benzonitrile REF: 10-F377647CAS: 182181-38-0	95.0%	To inquire	Tue 08 Apr 25
3-Fluoro-4-(1-Piperazinyl)-Benzonitrile REF: 3D-FF85075CAS: 182181-38-0	Min. 95%	- - -	Discontinued product