CAS 18228-16-5: N-(5-Chloro-2-methoxyphenyl)-3-(phosphonooxy)-2-naphthalenecarboxamide

Description:N-(5-Chloro-2-methoxyphenyl)-3-(phosphonooxy)-2-naphthalenecarboxamide, with the CAS number 18228-16-5, is a chemical compound that exhibits several notable characteristics. It features a complex structure that includes a naphthalene core, which is known for its aromatic properties, and a phosphonooxy group that contributes to its potential as a bioactive molecule. The presence of the chloro and methoxy substituents on the phenyl ring can influence its solubility, reactivity, and biological activity. This compound may exhibit properties such as being a potential herbicide or pharmaceutical agent, given its structural motifs that are often associated with biological activity. Additionally, the phosphono group can enhance its interaction with biological systems, possibly affecting enzyme activity or cellular processes. Overall, this compound's unique combination of functional groups and structural features makes it of interest in various fields, including medicinal chemistry and agricultural science.

Formula:C₁₈H₁₅ClNO₆P

InChI:InChI=1S/C18H15ClNO6P/c1-25-16-7-6-13(19)10-15(16)20-18(21)14-8-11-4-2-3-5-12(11)9-17(14)26-27(22,23)24/h2-10H,1H3,(H,20,21)(H2,22,23,24)

InChI key:InChIKey=AXMIMEOLDUCZOC-UHFFFAOYSA-N

SMILES:O=C(NC1=CC(Cl)=CC=C1OC)C2=CC=3C=CC=CC3C=C2OP(=O)(O)O