CAS 1823921-08-9: 4′-Bromo-1′,2′-dihydrospiro[cyclopropane-1,3′-[3H]indole]

Description:4′-Bromo-1′,2′-dihydrospiro[cyclopropane-1,3′-[3H]indole] is a chemical compound characterized by its unique spirocyclic structure, which consists of a cyclopropane ring fused to an indole moiety. The presence of a bromine atom at the 4′ position contributes to its reactivity and potential applications in medicinal chemistry. This compound is typically synthesized through specific organic reactions that allow for the formation of the spiro structure while introducing the bromine substituent. Its molecular framework suggests potential biological activity, making it a candidate for further investigation in drug development. The compound's properties, such as solubility, stability, and reactivity, can vary based on the functional groups present and the overall molecular configuration. As with many indole derivatives, it may exhibit interesting pharmacological properties, including effects on neurotransmitter systems or other biological pathways. However, detailed studies would be necessary to fully elucidate its characteristics and potential applications in various fields, including pharmaceuticals and materials science.

Formula:C₁₀H₁₀BrN

InChI:InChI=1S/C10H10BrN/c11-7-2-1-3-8-9(7)10(4-5-10)6-12-8/h1-3,12H,4-6H2

InChI key:InChIKey=YSJAOQKFRFLJOO-UHFFFAOYSA-N

SMILES:BrC1=CC=CC=2NCC3(C12)CC3