CAS 18242-39-2: 1-Bromo-3,5-dinitrobenzene

Description:1-Bromo-3,5-dinitrobenzene is an organic compound characterized by the presence of a bromine atom and two nitro groups attached to a benzene ring. Its molecular structure consists of a benzene ring substituted at the 1-position with a bromine atom and at the 3 and 5 positions with nitro groups, which are strong electron-withdrawing groups. This substitution pattern significantly influences its chemical reactivity and physical properties. The compound is typically a yellow crystalline solid, exhibiting moderate solubility in organic solvents such as acetone and ether, but limited solubility in water due to its nonpolar aromatic structure. 1-Bromo-3,5-dinitrobenzene is known for its applications in organic synthesis, particularly in the preparation of various dyes and pharmaceuticals. Additionally, it can serve as an intermediate in the synthesis of other chemical compounds. Due to the presence of nitro groups, it may also exhibit explosive properties under certain conditions, necessitating careful handling and storage.

Formula:C₆H₃BrN₂O₄

InChI:InChI=1S/C6H3BrN2O4/c7-4-1-5(8(10)11)3-6(2-4)9(12)13/h1-3H

InChI key:InChIKey=OLDMYNWXIGPOCI-UHFFFAOYSA-N

SMILES:O=N(=O)C1=CC(Br)=CC(=C1)N(=O)=O

Synonyms:
-Bromo-3,5-Dinitrobenzene
1-Bromo-3,5-dinitrobenzene
3,5-Dinitrobromobenzene
5-Bromo-1,3-dinitrobenzene
Benzene, 1-bromo-3,5-dinitro-

Found 5 products.

Product data	Purity	Price range	Estimated delivery
Benzene, 1-bromo-3,5-dinitro- REF: IN-DA0023VZCAS: 18242-39-2	98%	22.00 €~266.00 €	Thu 27 Mar 25
1-Bromo-3,5-dinitrobenzene REF: 54-OR307190CAS: 18242-39-2	99%	32.00 €~198.00 €	Fri 28 Mar 25
1-Bromo-3,5-dinitrobenzene REF: 10-F079271CAS: 18242-39-2	95.0%	20.00 €~332.00 €	Tue 01 Apr 25
1-Bromo-3,5-dinitrobenzene REF: 3B-B5627CAS: 18242-39-2	>98.0%(GC)	54.00 €~128.00 €	Tue 01 Apr 25
1-Bromo-3,5-dinitrobenzene REF: 3D-FB139862CAS: 18242-39-2	Min. 95%	177.00 €~1,365.00 €	Mon 07 Apr 25