CAS 1826110-25-1: Ethyl 5-bromo-2,6-dimethoxy-3-pyridinecarboxylate

Description:Ethyl 5-bromo-2,6-dimethoxy-3-pyridinecarboxylate is a chemical compound characterized by its pyridine ring, which is substituted at the 5-position with a bromine atom and at the 2 and 6 positions with methoxy groups. The presence of the ethyl ester functional group contributes to its reactivity and solubility properties. This compound is typically a pale yellow to light brown solid or liquid, depending on its purity and specific conditions. It is soluble in organic solvents such as ethanol and dichloromethane but may have limited solubility in water due to its hydrophobic methoxy groups. Ethyl 5-bromo-2,6-dimethoxy-3-pyridinecarboxylate may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its bromine substituent can also facilitate further chemical modifications, enhancing its utility in synthetic applications. As with many organic compounds, proper handling and safety precautions should be observed due to potential toxicity and reactivity.

Formula:C₁₀H₁₂BrNO₄

InChI:InChI=1S/C10H12BrNO4/c1-4-16-10(13)6-5-7(11)9(15-3)12-8(6)14-2/h5H,4H2,1-3H3

InChI key:InChIKey=ZSJYDZAGLWQUJE-UHFFFAOYSA-N

SMILES:O=C(OCC)C1=CC(Br)=C(N=C1OC)OC

Synonyms:
Ethyl 5-bromo-2,6-dimethoxy-3-pyridinecarboxylate
3-Pyridinecarboxylic acid, 5-bromo-2,6-dimethoxy-, ethyl ester

Found 3 products.

Product data	Purity	Price range	Estimated delivery
3-Pyridinecarboxylic acid, 5-bromo-2,6-dimethoxy-, ethyl ester REF: IN-DA01Q6TMCAS: 1826110-25-1	95%	To inquire	Thu 27 Mar 25
Ethyl 5-bromo-2,6-dimethoxypyridine-3-carboxylate REF: 10-F631668CAS: 1826110-25-1	95%	- - -	Discontinued product
Ethyl 5-bromo-2,6-dimethoxypyridine-3-carboxylate REF: 3D-BYC11025CAS: 1826110-25-1	Min. 95%	- - -	Discontinued product