CAS 183483-15-0: 4-(8-Chloro-5,6-dihydro-3-hydroxy-11H-benzo[5,6]cyclohepta[1,2-b]pyridin-11-ylidene)-1-piperidinecarboxylic Acid Ethyl Ester
Description:4-(8-Chloro-5,6-dihydro-3-hydroxy-11H-benzo[5,6]cyclohepta[1,2-b]pyridin-11-ylidene)-1-piperidinecarboxylic Acid Ethyl Ester, with CAS number 183483-15-0, is a chemical compound characterized by its complex structure, which includes a piperidine ring and a benzo[5,6]cyclohepta[1,2-b]pyridine moiety. This compound features a chloro substituent and a hydroxyl group, contributing to its potential biological activity. The presence of the ethyl ester functional group suggests that it may exhibit lipophilic properties, which can influence its solubility and permeability in biological systems. The compound's unique structural features may allow it to interact with specific biological targets, making it of interest in medicinal chemistry and pharmacology. Its synthesis and characterization would typically involve standard organic chemistry techniques, and its properties could be further explored through various analytical methods, including NMR, mass spectrometry, and chromatography. Overall, this compound represents a class of molecules that may have therapeutic potential, warranting further investigation into its biological effects and mechanisms of action.
Formula:C22H23ClN2O3
InChI:InChI=1/C22H23ClN2O3/c1-2-28-22(27)25-9-7-14(8-10-25)20-19-6-5-17(23)11-15(19)3-4-16-12-18(26)13-24-21(16)20/h5-6,11-13,26H,2-4,7-10H2,1H3
- Synonyms:
- 3-Hydroxy Loratadine