CAS 18395-93-2: Heptylmethyldichlorosilane
Description:Heptylmethyldichlorosilane, with the CAS number 18395-93-2, is an organosilicon compound characterized by its silane structure, which includes a silicon atom bonded to two chlorine atoms and a heptyl and a methyl group. This compound is typically a colorless to pale yellow liquid with a distinctive odor. It is known for its reactivity, particularly in hydrolysis, where it can react with moisture to produce silanol and hydrochloric acid. Heptylmethyldichlorosilane is often utilized in the synthesis of silicone polymers and as a coupling agent in various chemical processes. Its hydrophobic properties make it useful in applications requiring water repellency. However, due to the presence of chlorine, it can be hazardous, necessitating careful handling and storage to avoid exposure. Overall, this compound is significant in materials science and chemical manufacturing, contributing to the development of advanced silicone-based materials.
Formula:C8H18Cl2Si
InChI:InChI=1S/C8H18Cl2Si/c1-3-4-5-6-7-8-11(2,9)10/h3-8H2,1-2H3
InChI key:InChIKey=LFHKZPRSRNZHDM-UHFFFAOYSA-N
SMILES:Cl[Si](Cl)(C)CCCCCCC
- Synonyms:
- Dichloro(Heptyl)Methylsilane
- Dichloroheptylmethylsilane
- Heptylmethyldichlorosilane
- Silane, dichloroheptylmethyl-
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | n-Heptylmethyldichlorosilane REF: 10-S25172CAS: 18395-93-2 | - - - | - - - | Discontinued product |
![]() | N-Heptylmethyldichlorosilane REF: 3D-TAA39593CAS: 18395-93-2 | Min. 95% | - - - | Discontinued product |

n-Heptylmethyldichlorosilane
Ref: 10-S25172
25g | Discontinued | Request information |

N-Heptylmethyldichlorosilane
Ref: 3D-TAA39593
10g | Discontinued | Request information | |
25g | Discontinued | Request information | |
50g | Discontinued | Request information |