CAS 184163-49-3: 2-chloro-5-hydrazinylbenzoic acid hydrochloride (1:1)

Description: 2-Chloro-5-hydrazinylbenzoic acid hydrochloride (1:1) is a chemical compound characterized by its hydrazine and carboxylic acid functional groups, which contribute to its reactivity and potential applications in medicinal chemistry. The presence of a chlorine atom at the 2-position of the benzoic acid ring enhances its electrophilic properties, making it suitable for various chemical reactions. The hydrazinyl group at the 5-position can participate in condensation reactions, potentially leading to the formation of hydrazones or other derivatives. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which is advantageous for biological assays and pharmaceutical formulations. This compound may exhibit biological activity, making it of interest in drug development, particularly in the context of anti-cancer or anti-inflammatory agents. However, specific safety and handling precautions should be observed due to the presence of the hydrazine moiety, which is known for its toxicity and potential carcinogenicity. Overall, 2-chloro-5-hydrazinylbenzoic acid hydrochloride is a versatile compound with significant implications in chemical research and development.

Formula: C₇H₈Cl₂N₂O₂

InChI: InChI=1/C7H7ClN2O2.ClH/c8-6-2-1-4(10-9)3-5(6)7(11)12;/h1-3,10H,9H2,(H,11,12);1H

2-Chloro-5-hydrazinylbenzoic acid hydrochloride

CAS: 184163-49-3

Versatile small molecule scaffold

• Formula: C₇H₈Cl₂N₂O₂
• Purity: Min. 95%
• Molecular weight: 223.05 g/mol

2-Chloro-5-hydrazinylbenzoic acid hydrochloride

CAS: 184163-49-3

• Purity: 95%
• Molecular weight: 223.0500030517578