CAS 184766-62-9: 5-[4-[2-[5-(2-METHYL-1,3-DIOXOLAN-2-YL)-2-PYRIDYL]ETHOXY]-BENZYLIDENE]-2,4-THIAZOLIDINEDIONE
Description:5-[4-[2-[5-(2-Methyl-1,3-dioxolan-2-yl)-2-pyridyl]ethoxy]-benzylidene]-2,4-thiazolidinedione, with the CAS number 184766-62-9, is a synthetic organic compound characterized by its complex molecular structure, which includes a thiazolidinedione core, a pyridine ring, and a dioxolane moiety. This compound is notable for its potential biological activity, particularly in the field of medicinal chemistry, where thiazolidinediones are often investigated for their roles in glucose metabolism and as anti-diabetic agents. The presence of the dioxolane group may enhance its solubility and bioavailability. Additionally, the compound's structure suggests potential interactions with various biological targets, making it a subject of interest for further pharmacological studies. Its synthesis typically involves multi-step organic reactions, and it may exhibit specific physical properties such as melting point, solubility, and stability, which are crucial for its application in research and development. As with many synthetic compounds, safety and handling precautions are essential due to potential toxicity or reactivity.
Formula:C21H20N2O5S
InChI:InChI=1/C21H20N2O5S/c1-21(27-10-11-28-21)15-4-5-16(22-13-15)8-9-26-17-6-2-14(3-7-17)12-18-19(24)23-20(25)29-18/h2-7,12-13H,8-11H2,1H3,(H,23,24,25)/b18-12-
- Synonyms:
- 5-[[4-[2-[5-(2-Methyl-1,3-dioxolan-2-yl)-2-pyridinyl]ethoxy]phenyl]methylene]-2,4-thiazolidinedione
- (5Z)-5-[(4-{2-[5-(2-methyl-1,3-dioxolan-2-yl)pyridin-2-yl]ethoxy}phenyl)methylidene]-1,3-thiazolidine-2,4-dione
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 5-[4-[2-[5-(2-Methyl-1,3-dioxolan-2-yl)-2-pyridyl]ethoxy]benzylidene]-2,4-thiazolidinedione REF: TR-M303675CAS: 184766-62-9 | - - - | 186.00 €~432.00 € | Tue 15 Apr 25 |
![]() | 5-[4-[2-[5-(2-Methyl-1,3-dioxolan-2-yl)-2-pyridyl]ethoxy]benzylidene]-2,4-thiazolidinedione REF: 3D-FM25602CAS: 184766-62-9 | Min. 95% | - - - | Discontinued product |

5-[4-[2-[5-(2-Methyl-1,3-dioxolan-2-yl)-2-pyridyl]ethoxy]benzylidene]-2,4-thiazolidinedione
Controlled ProductRef: TR-M303675
2mg | 186.00 € | ||
5mg | 230.00 € | ||
10mg | 432.00 € |

5-[4-[2-[5-(2-Methyl-1,3-dioxolan-2-yl)-2-pyridyl]ethoxy]benzylidene]-2,4-thiazolidinedione
Ref: 3D-FM25602
2mg | Discontinued | Request information | |
5mg | Discontinued | Request information | |
10mg | Discontinued | Request information | |
25mg | Discontinued | Request information | |
50mg | Discontinued | Request information |