CAS 185225-06-3: (3aR,4R,5R,6aS)-5-(Benzoyloxy)hexahydro-4-(3-oxo-1-octen-1-yl)-2H-cyclopenta[b]furan-2-one
Description:The chemical substance with the name "(3aR,4R,5R,6aS)-5-(Benzoyloxy)hexahydro-4-(3-oxo-1-octen-1-yl)-2H-cyclopenta[b]furan-2-one" and CAS number "185225-06-3" is a complex organic compound characterized by its unique bicyclic structure, which includes a cyclopentafuran moiety. This compound features multiple stereocenters, contributing to its specific three-dimensional configuration, which can influence its biological activity and reactivity. The presence of a benzoyloxy group indicates potential for reactivity in substitution reactions, while the hexahydro structure suggests it is a saturated derivative, likely contributing to its stability. The ketone functionality (3-oxo) and the octenyl side chain imply potential for further chemical transformations and interactions, making it of interest in synthetic organic chemistry and possibly in medicinal chemistry. Its specific stereochemistry and functional groups may also play a role in its interactions with biological systems, which could be relevant for applications in pharmaceuticals or agrochemicals. Overall, this compound exemplifies the complexity and diversity found in organic molecules.
Formula:C22H26O5
InChI:InChI=1/C22H26O5/c1-2-3-5-10-16(23)11-12-17-18-13-21(24)26-20(18)14-19(17)27-22(25)15-8-6-4-7-9-15/h4,6-9,11-12,17-20H,2-3,5,10,13-14H2,1H3/b12-11+/t17-,18-,19-,20+/m1/s1
- Synonyms:
- (3aR,4R,5R,6aS)-2-oxo-4-[(1E)-3-oxooct-1-en-1-yl]hexahydro-2H-cyclopenta[b]furan-5-yl benzoate
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | (3AR,4R,5R,6aS)-5-(benzoyloxy)hexahydro-4-(3-oxo-1-octen-1-yl)-2H-cyclopenta[b]furan-2-one REF: 3D-FB152451CAS: 185225-06-3 | Min. 95% | - - - | Discontinued product |

(3AR,4R,5R,6aS)-5-(benzoyloxy)hexahydro-4-(3-oxo-1-octen-1-yl)-2H-cyclopenta[b]furan-2-one
Ref: 3D-FB152451
2mg | Discontinued | Request information | |
5mg | Discontinued | Request information | |
10mg | Discontinued | Request information | |
25mg | Discontinued | Request information | |
50mg | Discontinued | Request information |