CAS 18527-31-6: 5-{[(4-chlorophenyl)thio]methyl}-1H-1,2,3,4-tetraazole

Description: 5-{[(4-chlorophenyl)thio]methyl}-1H-1,2,3,4-tetraazole is a chemical compound characterized by its unique structure, which includes a tetraazole ring—a five-membered heterocyclic ring containing four nitrogen atoms and one carbon atom. The presence of a thioether group, specifically a thioether linkage to a 4-chlorophenyl group, contributes to its reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. This compound may exhibit properties such as antimicrobial or antifungal activity, owing to the presence of the tetraazole moiety, which is known for its biological significance. Additionally, the chlorophenyl substituent can influence the compound's lipophilicity and overall biological activity. The molecular structure and functional groups present in this compound suggest that it may participate in various chemical reactions, making it of interest for synthetic chemistry and medicinal research. As with many chemical substances, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₈H₇ClN₄S

InChI: InChI=1/C8H7ClN4S/c9-6-1-3-7(4-2-6)14-5-8-10-12-13-11-8/h1-4H,5H2,(H,10,11,12,13)

Synonyms:

• 5-{[(4-chlorophenyl)sulfanyl]methyl}-2H-tetrazole

5-{[(4-Chlorophenyl)sulfanyl]methyl}-1H-1,2,3,4-tetrazole

CAS: 18527-31-6

Versatile small molecule scaffold

• Formula: C₈H₇ClN₄S
• Purity: Min. 95%
• Molecular weight: 226.69 g/mol

5-{[(4-chlorophenyl)sulfanyl]methyl}-2H-1,2,3,4-tetrazole

CAS: 18527-31-6

• Purity: 98%
• Molecular weight: 226.67999267578125