CAS 185526-66-3: 1′-[(1,1-Dimethylethoxy)carbonyl]-2,3-dihydrospiro[1H-indene-1,4′-piperidine]-3-acetic acid
Description:1′-[(1,1-Dimethylethoxy)carbonyl]-2,3-dihydrospiro[1H-indene-1,4′-piperidine]-3-acetic acid, with the CAS number 185526-66-3, is a chemical compound characterized by its complex structure, which includes a spirocyclic framework. This compound features a piperidine ring fused to an indene moiety, contributing to its unique three-dimensional shape. The presence of the 1,1-dimethylethoxycarbonyl group indicates that it has a protective group that can influence its reactivity and solubility. The acetic acid functional group suggests potential for hydrogen bonding and interactions with other molecules, which may affect its biological activity and solubility in various solvents. This compound may be of interest in medicinal chemistry due to its structural features, which could impart specific pharmacological properties. Its synthesis and characterization would typically involve standard organic chemistry techniques, and its applications could range from drug development to materials science, depending on its reactivity and interactions with biological systems.
Formula:C20H27NO4
InChI:InChI=1S/C20H27NO4/c1-19(2,3)25-18(24)21-10-8-20(9-11-21)13-14(12-17(22)23)15-6-4-5-7-16(15)20/h4-7,14H,8-13H2,1-3H3,(H,22,23)
InChI key:InChIKey=FARYIPWNEVTXDV-UHFFFAOYSA-N
SMILES:O=C(O)CC1C=2C=CC=CC2C3(CCN(C(=O)OC(C)(C)C)CC3)C1
- Synonyms:
- Spiro[1H-indene-1,4′-piperidine]-3-acetic acid, 1′-[(1,1-dimethylethoxy)carbonyl]-2,3-dihydro-
- 2-[1′-[(2-Methylpropan-2-yl)oxycarbonyl]spiro[1,2-dihydroindene-3,4′-piperidine]-1-yl]acetic acid
- 2-[1′-[(tert-Butoxy)carbonyl]-2,3-dihydrospiro[indene-1,4′-piperidine]-3-yl]acetic acid
- 1′-[(1,1-Dimethylethoxy)carbonyl]-2,3-dihydrospiro[1H-indene-1,4′-piperidine]-3-acetic acid

2-(1'-(tert-butoxycarbonyl)-2,3-dihydrospiro[indene-1,4'-piperidine]-3-yl)acetic acid
Ref: IN-DA00AP5G
250mg | 292.00 € |

2-(1'-(tert-Butoxycarbonyl)-2,3-dihydrospiro[indene-1,4'-piperidine]-3-yl)acetic acid
Ref: 54-OR315454
1g | 994.00 € | ||
100mg | 204.00 € | ||
250mg | 358.00 € |

2-(1'-(tert-Butoxycarbonyl)-2,3-dihydrospiro[indene-1,4'-piperidin]-3-yl)acetic acid
Ref: 10-F601926
1g | To inquire | ||
100mg | 183.00 € | ||
250mg | 288.00 € |

1'-Boc-2,3-dihydrospiro[indene-1,4'-piperidine]-3-acetic acid
Ref: 3D-KHA52666
1g | Discontinued | Request information | |
500mg | Discontinued | Request information |