CAS 1856096-40-6: 1H-Pyrazole, 3-[(2,2-difluoroethoxy)methyl]-1-(difluoromethyl)-

Description:1H-Pyrazole, 3-[(2,2-difluoroethoxy)methyl]-1-(difluoromethyl)- is a synthetic organic compound characterized by its pyrazole core, which is a five-membered ring containing two adjacent nitrogen atoms. This compound features a difluoromethyl group and a difluoroethoxy substituent, contributing to its unique chemical properties. The presence of fluorine atoms typically enhances the compound's lipophilicity and metabolic stability, making it of interest in pharmaceutical applications. The pyrazole moiety is known for its biological activity, often serving as a scaffold in drug design. Additionally, the compound's structure suggests potential reactivity due to the presence of functional groups that can participate in various chemical reactions. Its CAS number, 1856096-40-6, allows for precise identification in chemical databases. Overall, this compound may exhibit interesting pharmacological properties, warranting further investigation in medicinal chemistry and related fields.

Formula:C₇H₈F₄N₂O

InChI:InChI=1S/C7H8F4N2O/c8-6(9)4-14-3-5-1-2-13(12-5)7(10)11/h1-2,6-7H,3-4H2

InChI key:InChIKey=RORCZQYSAFWEKG-UHFFFAOYSA-N

SMILES:FC(F)N1N=C(C=C1)COCC(F)F