CAS 1873-88-7: 1,1,1,3,5,5,5-Heptamethyltrisiloxane
Description:1,1,1,3,5,5,5-Heptamethyltrisiloxane, with the CAS number 1873-88-7, is a siloxane compound characterized by its unique structure, which consists of a siloxane backbone with multiple methyl groups attached. This compound typically exhibits low viscosity and high thermal stability, making it suitable for various applications, including as a lubricant, surfactant, or in cosmetic formulations. Its chemical structure contributes to its hydrophobic properties, allowing it to repel water and resist moisture, which is advantageous in formulations requiring water resistance. Additionally, the presence of multiple methyl groups enhances its volatility and reduces surface tension, which can improve spreading and wetting properties in formulations. The compound is generally considered to be non-toxic and environmentally friendly, aligning with the increasing demand for sustainable chemical products. However, like many siloxanes, it should be handled with care to avoid potential environmental impacts, particularly in aquatic systems. Overall, 1,1,1,3,5,5,5-Heptamethyltrisiloxane is valued for its versatility and effectiveness in various industrial and consumer applications.
Formula:C7H22O2Si3
InChI:InChI=1S/C7H22O2Si3/c1-10(8-11(2,3)4)9-12(5,6)7/h10H,1-7H3
InChI key:InChIKey=QNWOFLWXQGHSRH-UHFFFAOYSA-N
SMILES:O([SiH](O[Si](C)(C)C)C)[Si](C)(C)C
- Synonyms:
- 1,1,1,3,5,5,5-Heptamethylsiloxane
- 1,1,1,3,5,5,5-Heptamethyltrisiloxane
- 1,3,3,3-Tetramethyl-1-[(Trimethylsilyl)Oxy]Disiloxanyl
- 2,2,4,6,6-Pentamethyl-3,5-dioxa-2,4,6-trisilaheptane
- 2-Hydro-1,1,1,2,3,3,3-heptamethyltrisiloxane
- Bis(trimethylsilyloxy)methylsilane
- Heptamethylhydrotrisiloxane
- Heptamethyltrisiloxane
- Methylbis(trimethylsiloxy)silane
- Methylbis(trimethylsilyloxy)silane
- See more synonyms
- Sib 1844
- Sib 1844.0
- Trisiloxane, 1,1,1,3,5,5,5-heptamethyl-
