CAS 1877-71-0: Monomethyl isophthalate
Description:Monomethyl isophthalate (MMIP) is an aromatic ester derived from isophthalic acid and methanol. It is characterized by its molecular structure, which includes a methyl group attached to one of the carboxylic acid groups of isophthalic acid, resulting in a compound with the formula C10H10O4. MMIP is typically a colorless to pale yellow liquid with a moderate boiling point and is soluble in organic solvents such as ethanol and acetone, but has limited solubility in water. This compound is primarily used as an intermediate in the synthesis of various polymers and resins, particularly in the production of polyesters. Its properties include good thermal stability and resistance to hydrolysis, making it suitable for applications in coatings, adhesives, and plasticizers. Additionally, MMIP can exhibit low toxicity, but safety precautions should be taken during handling, as with all chemical substances. Overall, its unique characteristics make it valuable in industrial applications, particularly in the field of materials science.
Formula:C9H8O4
InChI:InChI=1S/C9H8O4/c1-13-9(12)7-4-2-3-6(5-7)8(10)11/h2-5H,1H3,(H,10,11)
InChI key:InChIKey=WMZNGTSLFSJHMZ-UHFFFAOYSA-N
SMILES:O=C(O)C1=CC=CC(=C1)C(=O)OC
- Synonyms:
- Monomethyl isophthalate
- Isophthalic acid monomethyl ester
- Benzene-1,3-dicarboxylic acid monomethyl ester
- 3-(Methoxycarbonyl)Benzoic Acid
- Mono-methyl isophthalate
- Methyl hydrogen isophthalate
- 1,3-Benzenedicarboxylic acid, monomethyl ester
- Isophthalic acid, methyl ester
- 1,3-Benzenedicarboxylic acid, 1-methyl ester
- Isophthalic acid methyl ester
- See more synonyms
