CAS 18792-01-3: 2,5-Dibromo-3-thiophenecarbonitrile
Description:2,5-Dibromo-3-thiophenecarbonitrile is an organic compound characterized by its unique structure, which includes a thiophene ring, bromine substituents, and a nitrile functional group. The presence of bromine atoms at the 2 and 5 positions of the thiophene ring enhances its reactivity and can influence its electronic properties, making it useful in various chemical applications, including organic synthesis and materials science. The nitrile group, located at the 3-position, contributes to the compound's polarity and can participate in further chemical reactions, such as nucleophilic additions. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its synthesis often involves halogenation and subsequent reactions to introduce the nitrile group. Due to its structural features, 2,5-Dibromo-3-thiophenecarbonitrile may have applications in the development of agrochemicals, pharmaceuticals, or as a building block in the synthesis of more complex organic molecules. Safety precautions should be taken when handling this compound, as it may pose health risks associated with brominated compounds.
Formula:C5HBr2NS
InChI:InChI=1S/C5HBr2NS/c6-4-1-3(2-8)5(7)9-4/h1H
InChI key:InChIKey=LUMVQVNVTYNDQS-UHFFFAOYSA-N
SMILES:N#CC=1C=C(Br)SC1Br
- Synonyms:
- 2,5-Dibromo-3-cyanothiophene
- 2,5-Dibromothiophene-3-carbonitrile
- 3-Cyano-2,5-dibromothiophene
- 3-Thiophenecarbonitrile, 2,5-dibromo-
- 2,5-Dibromo-3-thiophenecarbonitrile
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | 3-Thiophenecarbonitrile, 2,5-dibromo- REF: IN-DA002GKOCAS: 18792-01-3 | - - - | To inquire | Thu 27 Mar 25 |
 | 2,5-Dibromothiophene-3-carbonitrile REF: 54-OR55333CAS: 18792-01-3 | - - - | 811.00 €~1,213.00 € | Thu 03 Apr 25 |
 | 2,5-Dibromothiophene-3-carbonitrile REF: 10-F718421CAS: 18792-01-3 | 95+% | - - - | Discontinued product |
 | 2,5-Dibromothiophene-3-carbonitrile REF: 3D-FD162620CAS: 18792-01-3 | Min. 95% | - - - | Discontinued product |
Ref: IN-DA002GKO
| Undefined size | To inquire |
Ref: 54-OR55333
| 100mg | 811.00 € | ||
| 250mg | 1,060.00 € |
Ref: 10-F718421
| 1g | Discontinued | Request information | |
| 250mg | Discontinued | Request information | |
| 500mg | Discontinued | Request information |
2,5-Dibromothiophene-3-carbonitrile
Ref: 3D-FD162620
| 10mg | Discontinued | Request information | |
| 25mg | Discontinued | Request information | |
| 50mg | Discontinued | Request information | |
| 100mg | Discontinued | Request information | |
| 250mg | Discontinued | Request information |
